Ligand name: BETA-CAROTENE
PDB ligand accession: BCR
DrugBank: DB06755
PubChem: 5280489
ChEMBL: CHEMBL1293
InChI Key: OENHQHLEOONYIE-JLTXGRSLSA-N
SMILES: CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2=C(CCCC2(C)C)C)C)C
Drug action: n/a

ClassyFire chemical classification:

• Kingdom: Organic compounds
  • Superclass: Lipids and lipid-like molecules
    • Class: Prenol lipids
      • Subclass: Tetraterpenoids

List of PDB structures and/or AlphaFold models with target protein P00166

PDB/AF Accession	PyMOL script	Experimental / Predicted	Interacting ECOD domains	ECOD X-group name	LigPlot
7QRM	Download	Experimental	e7qrmA1 e7qrmB1 e7qrmF1 e7qrmG1 e7qrmH1 e7qrmI1 e7qrmJ1 e7qrmN1 e7qrmO1 e7qrmP1	Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetM subunit of the cytochrome b6f complex PetG subunit of the cytochrome b6f complex PetN subunit of the cytochrome b6f complex Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetM subunit of the cytochrome b6f complex PetG subunit of the cytochrome b6f complex PetN subunit of the cytochrome b6f complex	LigPlot
7ZYV	Download	Experimental	e7zyvA1 e7zyvB1 e7zyvF1 e7zyvG1 e7zyvH1 e7zyvI1 e7zyvJ1 e7zyvN1 e7zyvO1 e7zyvP1	Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetM subunit of the cytochrome b6f complex PetG subunit of the cytochrome b6f complex PetN subunit of the cytochrome b6f complex Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetM subunit of the cytochrome b6f complex PetG subunit of the cytochrome b6f complex PetN subunit of the cytochrome b6f complex	LigPlot
6RQF	Download	Experimental	e6rqfI1 e6rqfJ1 e6rqfN1 e6rqfO1 e6rqfP1 e6rqfA1 e6rqfB1 e6rqfF1 e6rqfG1 e6rqfH1	Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetM subunit of the cytochrome b6f complex PetG subunit of the cytochrome b6f complex PetN subunit of the cytochrome b6f complex Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetM subunit of the cytochrome b6f complex PetG subunit of the cytochrome b6f complex PetN subunit of the cytochrome b6f complex	LigPlot