PDB ligand accession: DMU
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: WOQQAWHSKSSAGF-WXFJLFHKSA-N
SMILES: CCCCCCCCCCOC1C(C(C(C(O1)CO)OC2C(C(C(C(O2)CO)O)O)O)O)O
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Fatty Acyls
- Subclass: Fatty acyl glycosides
- Class: Fatty Acyls
- Superclass: Lipids and lipid-like molecules
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 8H8R | Download | Experimental | e8h8rA1 e8h8rB1 e8h8rT1 e8h8rA1 e8h8rC1 e8h8rJ1 e8h8rA1 e8h8rB1 e8h8rD1 e8h8rA1 e8h8rC1 e8h8rH1 e8h8rA1 e8h8rK1 e8h8rM1 e8h8rN1 e8h8rP1 e8h8rU1 e8h8rN1 e8h8rO1 e8h8rR1 e8h8rV1 e8h8rN1 e8h8rP1 e8h8rW1 e8h8rN1 e8h8rQ1 e8h8rN1 e8h8rX1 e8h8rZ1 | Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit II-like, transmembrane region Mitochondrial cytochrome c oxidase subunit VIa Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit II-like, transmembrane region Mitochondrial cytochrome c oxidase subunit IV Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Cytochrome c oxidase subunit h Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIb Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Cytochrome c oxidase subunit h Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit II-like, transmembrane region Repetitive alpha hairpins Mitochondrial cytochrome c oxidase subunit VIc Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIb Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 3AG3 | Download | Experimental | e3ag3A1 e3ag3D1 e3ag3L1 e3ag3M1 e3ag3N1 e3ag3Q1 e3ag3Y1 e3ag3Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 5W97 | Download | Experimental | e5w97A1 e5w97D1 e5w97L1 e5w97M1 e5w97a1 e5w97d1 e5w97l1 e5w97m1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 3ASN | Download | Experimental | e3asnA1 e3asnD1 e3asnL1 e3asnM1 e3asnN1 e3asnQ1 e3asnY1 e3asnZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 6NKN | Download | Experimental | e6nknA1 e6nknD1 e6nknL1 e6nknM1 e6nknN1 e6nknQ1 e6nknY1 e6nknZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 3WG7 | Download | Experimental | e3wg7A1 e3wg7D1 e3wg7L1 e3wg7M1 e3wg7N1 e3wg7Q1 e3wg7Y1 e3wg7Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 7VVR | Download | Experimental | e7vvrA1 e7vvrC1 e7vvrJ1 e7vvrA1 e7vvrJ1 e7vvrL1 e7vvrA1 e7vvrD1 e7vvrL1 e7vvrM1 e7vvrN1 e7vvrQ1 e7vvrY1 e7vvrZ1 | Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIa Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 7YPY | Download | Experimental | e7ypyA1 e7ypyA1 e7ypyJ1 e7ypyL1 e7ypyA1 e7ypyD1 e7ypyL1 e7ypyM1 e7ypyN1 e7ypyQ1 e7ypyY1 e7ypyZ1 | Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIa Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 5ZCO | Download | Experimental | e5zcoA1 e5zcoD1 e5zcoL1 e5zcoM1 e5zcoN1 e5zcoQ1 e5zcoY1 e5zcoZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 5IY5 | Download | Experimental | e5iy5D1 e5iy5L1 e5iy5A1 e5iy5M1 e5iy5N1 e5iy5Q1 e5iy5Y1 e5iy5Z1 | Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 3AG2 | Download | Experimental | e3ag2A1 e3ag2C1 e3ag2J1 e3ag2A1 e3ag2D1 e3ag2L1 e3ag2M1 | Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 7CP5 | Download | Experimental | e7cp5A1 e7cp5C1 e7cp5J1 e7cp5A1 e7cp5J1 e7cp5L1 e7cp5A1 e7cp5D1 e7cp5L1 e7cp5M1 e7cp5N1 e7cp5P1 e7cp5W1 e7cp5N1 e7cp5Q1 e7cp5Y1 e7cp5Z1 | Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIa Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 2EIN | Download | Experimental | e2einA1 e2einD1 e2einL1 e2einM1 e2einN1 e2einQ1 e2einY1 e2einZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 6NMF | Download | Experimental | e6nmfA1 e6nmfC1 e6nmfJ1 e6nmfA1 e6nmfD1 e6nmfL1 e6nmfM1 e6nmfN1 e6nmfP1 e6nmfW1 e6nmfN1 e6nmfQ1 e6nmfY1 e6nmfZ1 | Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 5WAU | Download | Experimental | e5wauA1 e5wauD1 e5wauL1 e5wauM1 e5waua1 e5waud1 e5waul1 e5waum1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 3AG1 | Download | Experimental | e3ag1A1 e3ag1D1 e3ag1L1 e3ag1M1 e3ag1N1 e3ag1Q1 e3ag1Y1 e3ag1Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 7D5X | Download | Experimental | e7d5xA1 e7d5xD1 e7d5xK1 e7d5xA1 e7d5xJ1 e7d5xL1 e7d5xA1 e7d5xD1 e7d5xL1 e7d5xM1 e7d5xN1 e7d5xQ1 e7d5xX1 e7d5xN1 e7d5xQ1 e7d5xY1 e7d5xZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIa Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 2DYR | Download | Experimental | e2dyrA1 e2dyrD1 e2dyrL1 e2dyrM1 e2dyrN1 e2dyrQ1 e2dyrY1 e2dyrZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 5XDX | Download | Experimental | e5xdxA1 e5xdxC1 e5xdxJ1 e5xdxA1 e5xdxD1 e5xdxL1 e5xdxM1 e5xdxN1 e5xdxP1 e5xdxW1 e5xdxN1 e5xdxQ1 e5xdxY1 e5xdxZ1 | Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 8IJN | Download | Experimental | e8ijnA1 e8ijnD1 e8ijnL1 e8ijnM1 e8ijnN1 e8ijnP1 e8ijnW1 e8ijnN1 e8ijnQ1 e8ijnY1 e8ijnZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 2EIK | Download | Experimental | e2eikA1 e2eikD1 e2eikL1 e2eikM1 e2eikN1 e2eikQ1 e2eikY1 e2eikZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 5Z84 | Download | Experimental | e5z84A1 e5z84J1 e5z84L1 e5z84A1 e5z84D1 e5z84L1 e5z84M1 e5z84N1 e5z84Q1 e5z84Y1 e5z84Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIa Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 5B1B | Download | Experimental | e5b1bA1 e5b1bD1 e5b1bK1 e5b1bA1 e5b1bJ1 e5b1bL1 e5b1bA1 e5b1bD1 e5b1bL1 e5b1bM1 e5b1bN1 e5b1bQ1 e5b1bY1 e5b1bZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIa Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 3ABK | Download | Experimental | e3abkA1 e3abkD1 e3abkL1 e3abkM1 e3abkN1 e3abkQ1 e3abkY1 e3abkZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 3ABM | Download | Experimental | e3abmA1 e3abmD1 e3abmL1 e3abmM1 e3abmN1 e3abmQ1 e3abmY1 e3abmZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 2DYS | Download | Experimental | e2dysA1 e2dysD1 e2dysL1 e2dysM1 e2dysN1 e2dysQ1 e2dysY1 e2dysZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 8GVM | Download | Experimental | e8gvmA1 e8gvmJ1 e8gvmL1 e8gvmA1 e8gvmD1 e8gvmL1 e8gvmM1 e8gvmN1 e8gvmQ1 e8gvmY1 e8gvmZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIa Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 2EIJ | Download | Experimental | e2eijA1 e2eijD1 e2eijL1 e2eijM1 e2eijN1 e2eijQ1 e2eijY1 e2eijZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 1V54 | Download | Experimental | e1v54A1 e1v54D1 e1v54L1 e1v54M1 e1v54N1 e1v54Q1 e1v54Y1 e1v54Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 8H8S | Download | Experimental | e8h8sA1 e8h8sB2 e8h8sT1 e8h8sA1 e8h8sC1 e8h8sJ1 e8h8sA1 e8h8sD1 e8h8sN1 e8h8sO1 e8h8sC1 e8h8sG1 e8h8sA1 e8h8sC1 e8h8sH1 e8h8sA1 e8h8sK1 e8h8sM1 e8h8sN1 e8h8sP1 e8h8sU1 e8h8sN1 e8h8sO1 e8h8sR1 e8h8sV1 e8h8sN1 e8h8sP1 e8h8sW1 e8h8sN1 e8h8sQ1 e8h8sA1 e8h8sB2 e8h8sP1 e8h8sT1 e8h8sN1 e8h8sX1 e8h8sZ1 | Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit II-like, transmembrane region Mitochondrial cytochrome c oxidase subunit VIa Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit II-like, transmembrane region Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIa Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Cytochrome c oxidase subunit h Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIb Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Cytochrome c oxidase subunit h Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit II-like, transmembrane region Repetitive alpha hairpins Mitochondrial cytochrome c oxidase subunit VIc Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit II-like, transmembrane region Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIb Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 5X1F | Download | Experimental | e5x1fA1 e5x1fD1 e5x1fL1 e5x1fM1 e5x1fN1 e5x1fQ1 e5x1fY1 e5x1fZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 5X19 | Download | Experimental | e5x19A1 e5x19D1 e5x19L1 e5x19M1 e5x19N1 e5x19Q1 e5x19Y1 e5x19Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 2EIL | Download | Experimental | e2eilA1 e2eilD1 e2eilL1 e2eilM1 e2eilN1 e2eilQ1 e2eilY1 e2eilZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 2EIM | Download | Experimental | e2eimA1 e2eimD1 e2eimL1 e2eimM1 e2eimN1 e2eimQ1 e2eimY1 e2eimZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 3ASO | Download | Experimental | e3asoA1 e3asoD1 e3asoL1 e3asoM1 e3asoN1 e3asoQ1 e3asoY1 e3asoZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 3AG4 | Download | Experimental | e3ag4A1 e3ag4D1 e3ag4L1 e3ag4M1 e3ag4N1 e3ag4Q1 e3ag4Y1 e3ag4Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 3ABL | Download | Experimental | e3ablA1 e3ablD1 e3ablL1 e3ablM1 e3ablN1 e3ablQ1 e3ablY1 e3ablZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 6JUW | Download | Experimental | e6juwA1 e6juwD1 e6juwK1 e6juwA1 e6juwC1 e6juwJ1 e6juwA1 e6juwJ1 e6juwL1 e6juwM1 e6juwA1 e6juwD1 e6juwL1 e6juwM1 e6juwN1 e6juwP1 e6juwW1 e6juwN1 e6juwW1 e6juwY1 e6juwN1 e6juwQ1 e6juwY1 e6juwZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIa Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIa Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 7VUW | Download | Experimental | e7vuwA1 e7vuwD1 e7vuwL1 e7vuwM1 e7vuwN1 e7vuwX1 e7vuwN1 e7vuwP1 e7vuwW1 e7vuwN1 e7vuwQ1 e7vuwY1 e7vuwZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 2Y69 | Download | Experimental | e2y69A1 e2y69D1 e2y69M1 e2y69L1 e2y69N1 e2y69Q1 e2y69Y1 e2y69Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 5X1B | Download | Experimental | e5x1bA1 e5x1bD1 e5x1bL1 e5x1bM1 e5x1bN1 e5x1bQ1 e5x1bY1 e5x1bZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 7XMA | Download | Experimental | e7xmaA1 e7xmaC1 e7xmaJ1 e7xmaA1 e7xmaD1 e7xmaL1 e7xmaM1 e7xmaN1 e7xmaP1 e7xmaW1 e7xmaN1 e7xmaQ1 e7xmaY1 e7xmaZ1 | Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 5XDQ | Download | Experimental | e5xdqA1 e5xdqC1 e5xdqJ1 e5xdqA1 e5xdqD1 e5xdqL1 e5xdqM1 e5xdqN1 e5xdqP1 e5xdqW1 e5xdqN1 e5xdqQ1 e5xdqY1 e5xdqZ1 | Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 5B3S | Download | Experimental | e5b3sA1 e5b3sC1 e5b3sJ1 e5b3sA1 e5b3sJ1 e5b3sL1 e5b3sM1 e5b3sN1 e5b3sQ1 e5b3sY1 e5b3sZ1 | Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIa Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 7D5W | Download | Experimental | e7d5wA1 e7d5wA1 e7d5wD1 e7d5wK1 e7d5wA1 e7d5wJ1 e7d5wL1 e7d5wA1 e7d5wD1 e7d5wL1 e7d5wM1 e7d5wN1 e7d5wQ1 e7d5wY1 e7d5wZ1 | Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIa Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 8GBT | Download | Experimental | e8gbtA1 e8gbtD1 e8gbtL1 e8gbtM1 e8gbtN1 e8gbtQ1 e8gbtY1 e8gbtZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 7XMB | Download | Experimental | e7xmbA1 e7xmbC1 e7xmbJ1 e7xmbA1 e7xmbD1 e7xmbL1 e7xmbM1 e7xmbN1 e7xmbP1 e7xmbW1 e7xmbN1 e7xmbQ1 e7xmbY1 e7xmbZ1 | Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 2ZXW | Download | Experimental | e2zxwA1 e2zxwD1 e2zxwL1 e2zxwM1 e2zxwN1 e2zxwQ1 e2zxwY1 e2zxwZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 1V55 | Download | Experimental | e1v55A1 e1v55D1 e1v55L1 e1v55M1 e1v55N1 e1v55Q1 e1v55Y1 e1v55Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 5Z86 | Download | Experimental | e5z86A1 e5z86D1 e5z86L1 e5z86M1 e5z86N1 e5z86Q1 e5z86Y1 e5z86Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 6J8M | Download | Experimental | e6j8mA1 e6j8mC1 e6j8mJ1 e6j8mA1 e6j8mD1 e6j8mL1 e6j8mM1 e6j8mN1 e6j8mP1 e6j8mW1 e6j8mN1 e6j8mQ1 e6j8mY1 e6j8mZ1 | Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 7Y44 | Download | Experimental | e7y44A1 e7y44A1 e7y44D1 e7y44K1 e7y44A1 e7y44J1 e7y44L1 e7y44M1 e7y44A1 e7y44D1 e7y44L1 e7y44M1 e7y44N1 e7y44P1 e7y44W1 e7y44N1 e7y44Q1 e7y44Y1 e7y44Z1 | Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIa Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 7COH | Download | Experimental | e7cohA1 e7cohD1 e7cohK1 e7cohM1 e7cohA1 e7cohB1 e7cohE1 e7cohI1 e7cohC1 e7cohG1 e7cohN1 e7cohO2 e7cohA1 e7cohC1 e7cohJ1 e7cohA1 e7cohK1 e7cohM1 e7cohN1 e7cohQ1 e7cohX1 e7cohZ1 e7cohN1 e7cohO2 e7cohR1 e7cohV1 e7cohA1 e7cohB1 e7cohP1 e7cohT1 e7cohN1 e7cohP1 e7cohW1 e7cohN1 e7cohX1 e7cohZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit II-like, transmembrane region Repetitive alpha hairpins Mitochondrial cytochrome c oxidase subunit VIc Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIa Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit II-like, transmembrane region Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIb Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit II-like, transmembrane region Repetitive alpha hairpins Mitochondrial cytochrome c oxidase subunit VIc Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit II-like, transmembrane region Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIa Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIb Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 5Z85 | Download | Experimental | e5z85A1 e5z85D1 e5z85L1 e5z85M1 e5z85N1 e5z85Q1 e5z85Y1 e5z85Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 3X2Q | Download | Experimental | e3x2qA1 e3x2qD1 e3x2qL1 e3x2qM1 e3x2qN1 e3x2qQ1 e3x2qY1 e3x2qZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 5ZCQ | Download | Experimental | e5zcqA1 e5zcqJ1 e5zcqL1 e5zcqA1 e5zcqD1 e5zcqL1 e5zcqM1 e5zcqN1 e5zcqQ1 e5zcqY1 e5zcqZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIa Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 5B1A | Download | Experimental | e5b1aA1 e5b1aC1 e5b1aJ1 e5b1aA1 e5b1aD1 e5b1aL1 e5b1aM1 e5b1aN1 e5b1aP1 e5b1aW1 e5b1aN1 e5b1aQ1 e5b1aY1 e5b1aZ1 | Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 6NMP | Download | Experimental | e6nmpA1 e6nmpD1 e6nmpL1 e6nmpM1 e6nmpN1 e6nmpQ1 e6nmpY1 e6nmpZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 7W3E | Download | Experimental | e7w3eA1 e7w3eC1 e7w3eJ1 e7w3eA1 e7w3eB1 e7w3eK1 e7w3eA1 e7w3eJ1 e7w3eL1 e7w3eA1 e7w3eD1 e7w3eL1 e7w3eM1 e7w3eN1 e7w3eX1 e7w3eN1 e7w3eQ1 e7w3eY1 e7w3eZ1 | Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit III-like Mitochondrial cytochrome c oxidase subunit VIIa Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit II-like, transmembrane region Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIa Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 5ZCP | Download | Experimental | e5zcpA1 e5zcpD1 e5zcpL1 e5zcpM1 e5zcpN1 e5zcpQ1 e5zcpY1 e5zcpZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
| 8GCQ | Download | Experimental | e8gcqA1 e8gcqD1 e8gcqL1 e8gcqM1 e8gcqN1 e8gcqQ1 e8gcqY1 e8gcqZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |