PDB ligand accession: DMU
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: WOQQAWHSKSSAGF-WXFJLFHKSA-N
SMILES: CCCCCCCCCCOC1C(C(C(C(O1)CO)OC2C(C(C(C(O2)CO)O)O)O)O)O
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Fatty Acyls
- Subclass: Fatty acyl glycosides
- Class: Fatty Acyls
- Superclass: Lipids and lipid-like molecules
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
8H8R | Download | Experimental | e8h8rA1 e8h8rB1 e8h8rD1 e8h8rN1 e8h8rQ1 | Cytochrome c oxidase subunit I-like Cytochrome c oxidase subunit II-like, transmembrane region Mitochondrial cytochrome c oxidase subunit IV Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV | LigPlot |
3AG3 | Download | Experimental | e3ag3A1 e3ag3D1 e3ag3L1 e3ag3M1 e3ag3N1 e3ag3Q1 e3ag3Y1 e3ag3Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
5W97 | Download | Experimental | e5w97A1 e5w97D1 e5w97L1 e5w97M1 e5w97a1 e5w97d1 e5w97l1 e5w97m1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
3ASN | Download | Experimental | e3asnA1 e3asnD1 e3asnL1 e3asnM1 e3asnN1 e3asnQ1 e3asnY1 e3asnZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
6NKN | Download | Experimental | e6nknA1 e6nknD1 e6nknL1 e6nknM1 e6nknN1 e6nknQ1 e6nknY1 e6nknZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
3WG7 | Download | Experimental | e3wg7A1 e3wg7D1 e3wg7L1 e3wg7M1 e3wg7N1 e3wg7Q1 e3wg7Y1 e3wg7Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
7VVR | Download | Experimental | e7vvrA1 e7vvrD1 e7vvrL1 e7vvrM1 e7vvrN1 e7vvrQ1 e7vvrY1 e7vvrZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
7YPY | Download | Experimental | e7ypyD1 e7ypyD1 e7ypyK1 e7ypyA1 e7ypyD1 e7ypyL1 e7ypyM1 e7ypyN1 e7ypyQ1 e7ypyY1 e7ypyZ1 | Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
5ZCO | Download | Experimental | e5zcoA1 e5zcoD1 e5zcoL1 e5zcoM1 e5zcoN1 e5zcoQ1 e5zcoY1 e5zcoZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
5IY5 | Download | Experimental | e5iy5D1 e5iy5L1 e5iy5A1 e5iy5M1 e5iy5N1 e5iy5Q1 e5iy5Y1 e5iy5Z1 | Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
3AG2 | Download | Experimental | e3ag2A1 e3ag2D1 e3ag2L1 e3ag2M1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
7CP5 | Download | Experimental | e7cp5D1 e7cp5D1 e7cp5K1 e7cp5A1 e7cp5D1 e7cp5L1 e7cp5M1 e7cp5Q1 e7cp5Q1 e7cp5X1 e7cp5N1 e7cp5Q1 e7cp5Y1 e7cp5Z1 | Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
2EIN | Download | Experimental | e2einA1 e2einD1 e2einL1 e2einM1 e2einN1 e2einQ1 e2einY1 e2einZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
6NMF | Download | Experimental | e6nmfA1 e6nmfD1 e6nmfL1 e6nmfM1 e6nmfN1 e6nmfQ1 e6nmfY1 e6nmfZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
5WAU | Download | Experimental | e5wauA1 e5wauD1 e5wauL1 e5wauM1 e5waua1 e5waud1 e5waul1 e5waum1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
3AG1 | Download | Experimental | e3ag1A1 e3ag1D1 e3ag1L1 e3ag1M1 e3ag1N1 e3ag1Q1 e3ag1Y1 e3ag1Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
7D5X | Download | Experimental | e7d5xA1 e7d5xD1 e7d5xK1 e7d5xD1 e7d5xD1 e7d5xK1 e7d5xA1 e7d5xD1 e7d5xL1 e7d5xM1 e7d5xN1 e7d5xQ1 e7d5xX1 e7d5xQ1 e7d5xZ1 e7d5xQ1 e7d5xX1 e7d5xN1 e7d5xQ1 e7d5xY1 e7d5xZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
2DYR | Download | Experimental | e2dyrA1 e2dyrD1 e2dyrL1 e2dyrM1 e2dyrN1 e2dyrQ1 e2dyrY1 e2dyrZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
5XDX | Download | Experimental | e5xdxA1 e5xdxD1 e5xdxL1 e5xdxM1 e5xdxN1 e5xdxQ1 e5xdxY1 e5xdxZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
8IJN | Download | Experimental | e8ijnA1 e8ijnD1 e8ijnL1 e8ijnM1 e8ijnN1 e8ijnQ1 e8ijnY1 e8ijnZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
2EIK | Download | Experimental | e2eikA1 e2eikD1 e2eikL1 e2eikM1 e2eikN1 e2eikQ1 e2eikY1 e2eikZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
5Z84 | Download | Experimental | e5z84A1 e5z84D1 e5z84L1 e5z84M1 e5z84N1 e5z84Q1 e5z84Y1 e5z84Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
5B1B | Download | Experimental | e5b1bD1 e5b1bA1 e5b1bD1 e5b1bK1 e5b1bA1 e5b1bD1 e5b1bL1 e5b1bM1 e5b1bQ1 e5b1bX1 e5b1bN1 e5b1bQ1 e5b1bY1 e5b1bZ1 | Mitochondrial cytochrome c oxidase subunit IV Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
3ABK | Download | Experimental | e3abkA1 e3abkD1 e3abkL1 e3abkM1 e3abkN1 e3abkQ1 e3abkY1 e3abkZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
3ABM | Download | Experimental | e3abmA1 e3abmD1 e3abmL1 e3abmM1 e3abmN1 e3abmQ1 e3abmY1 e3abmZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
2DYS | Download | Experimental | e2dysA1 e2dysD1 e2dysL1 e2dysM1 e2dysN1 e2dysQ1 e2dysY1 e2dysZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
8GVM | Download | Experimental | e8gvmA1 e8gvmD1 e8gvmL1 e8gvmM1 e8gvmN1 e8gvmQ1 e8gvmY1 e8gvmZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
2EIJ | Download | Experimental | e2eijA1 e2eijD1 e2eijL1 e2eijM1 e2eijN1 e2eijQ1 e2eijY1 e2eijZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
1V54 | Download | Experimental | e1v54A1 e1v54D1 e1v54L1 e1v54M1 e1v54N1 e1v54Q1 e1v54Y1 e1v54Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
8H8S | Download | Experimental | e8h8sA1 e8h8sD1 e8h8sN1 e8h8sQ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV | LigPlot |
5X1F | Download | Experimental | e5x1fA1 e5x1fD1 e5x1fL1 e5x1fM1 e5x1fN1 e5x1fQ1 e5x1fY1 e5x1fZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
5X19 | Download | Experimental | e5x19A1 e5x19D1 e5x19L1 e5x19M1 e5x19N1 e5x19Q1 e5x19Y1 e5x19Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
2EIL | Download | Experimental | e2eilA1 e2eilD1 e2eilL1 e2eilM1 e2eilN1 e2eilQ1 e2eilY1 e2eilZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
2EIM | Download | Experimental | e2eimA1 e2eimD1 e2eimL1 e2eimM1 e2eimN1 e2eimQ1 e2eimY1 e2eimZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
3ASO | Download | Experimental | e3asoA1 e3asoD1 e3asoL1 e3asoM1 e3asoN1 e3asoQ1 e3asoY1 e3asoZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
3AG4 | Download | Experimental | e3ag4A1 e3ag4D1 e3ag4L1 e3ag4M1 e3ag4N1 e3ag4Q1 e3ag4Y1 e3ag4Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
3ABL | Download | Experimental | e3ablA1 e3ablD1 e3ablL1 e3ablM1 e3ablN1 e3ablQ1 e3ablY1 e3ablZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
6JUW | Download | Experimental | e6juwA1 e6juwD1 e6juwK1 e6juwD1 e6juwK1 e6juwM1 e6juwA1 e6juwD1 e6juwL1 e6juwM1 e6juwQ1 e6juwX1 e6juwN1 e6juwQ1 e6juwY1 e6juwZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
7VUW | Download | Experimental | e7vuwA1 e7vuwD1 e7vuwL1 e7vuwM1 e7vuwQ1 e7vuwX1 e7vuwN1 e7vuwQ1 e7vuwY1 e7vuwZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
2Y69 | Download | Experimental | e2y69A1 e2y69D1 e2y69M1 e2y69L1 e2y69N1 e2y69Q1 e2y69Y1 e2y69Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
5X1B | Download | Experimental | e5x1bA1 e5x1bD1 e5x1bL1 e5x1bM1 e5x1bN1 e5x1bQ1 e5x1bY1 e5x1bZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
7XMA | Download | Experimental | e7xmaA1 e7xmaD1 e7xmaL1 e7xmaM1 e7xmaN1 e7xmaQ1 e7xmaY1 e7xmaZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
5XDQ | Download | Experimental | e5xdqA1 e5xdqD1 e5xdqL1 e5xdqM1 e5xdqN1 e5xdqQ1 e5xdqY1 e5xdqZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
5B3S | Download | Experimental | e5b3sD1 e5b3sK1 e5b3sQ1 e5b3sX1 e5b3sN1 e5b3sQ1 e5b3sY1 e5b3sZ1 | Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
7D5W | Download | Experimental | e7d5wD1 e7d5wA1 e7d5wD1 e7d5wK1 e7d5wA1 e7d5wD1 e7d5wL1 e7d5wM1 e7d5wQ1 e7d5wX1 e7d5wN1 e7d5wQ1 e7d5wY1 e7d5wZ1 | Mitochondrial cytochrome c oxidase subunit IV Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
8GBT | Download | Experimental | e8gbtA1 e8gbtD1 e8gbtL1 e8gbtM1 e8gbtN1 e8gbtQ1 e8gbtY1 e8gbtZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
7XMB | Download | Experimental | e7xmbA1 e7xmbD1 e7xmbL1 e7xmbM1 e7xmbN1 e7xmbQ1 e7xmbY1 e7xmbZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
2ZXW | Download | Experimental | e2zxwA1 e2zxwD1 e2zxwL1 e2zxwM1 e2zxwN1 e2zxwQ1 e2zxwY1 e2zxwZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
1V55 | Download | Experimental | e1v55A1 e1v55D1 e1v55L1 e1v55M1 e1v55N1 e1v55Q1 e1v55Y1 e1v55Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
5Z86 | Download | Experimental | e5z86A1 e5z86D1 e5z86L1 e5z86M1 e5z86N1 e5z86Q1 e5z86Y1 e5z86Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
6J8M | Download | Experimental | e6j8mA1 e6j8mD1 e6j8mL1 e6j8mM1 e6j8mN1 e6j8mQ1 e6j8mY1 e6j8mZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
7Y44 | Download | Experimental | e7y44D1 e7y44A1 e7y44D1 e7y44K1 e7y44A1 e7y44D1 e7y44L1 e7y44M1 e7y44Q1 e7y44X1 e7y44N1 e7y44Q1 e7y44Y1 e7y44Z1 | Mitochondrial cytochrome c oxidase subunit IV Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
7COH | Download | Experimental | e7cohA1 e7cohD1 e7cohK1 e7cohM1 e7cohN1 e7cohQ1 e7cohX1 e7cohZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIb Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
5Z85 | Download | Experimental | e5z85A1 e5z85D1 e5z85L1 e5z85M1 e5z85N1 e5z85Q1 e5z85Y1 e5z85Z1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
3X2Q | Download | Experimental | e3x2qA1 e3x2qD1 e3x2qL1 e3x2qM1 e3x2qN1 e3x2qQ1 e3x2qY1 e3x2qZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
5ZCQ | Download | Experimental | e5zcqA1 e5zcqD1 e5zcqL1 e5zcqM1 e5zcqN1 e5zcqQ1 e5zcqY1 e5zcqZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
5B1A | Download | Experimental | e5b1aA1 e5b1aD1 e5b1aL1 e5b1aM1 e5b1aN1 e5b1aQ1 e5b1aY1 e5b1aZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
6NMP | Download | Experimental | e6nmpA1 e6nmpD1 e6nmpL1 e6nmpM1 e6nmpN1 e6nmpQ1 e6nmpY1 e6nmpZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
7W3E | Download | Experimental | e7w3eA1 e7w3eD1 e7w3eL1 e7w3eM1 e7w3eN1 e7w3eQ1 e7w3eY1 e7w3eZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
5ZCP | Download | Experimental | e5zcpA1 e5zcpD1 e5zcpL1 e5zcpM1 e5zcpN1 e5zcpQ1 e5zcpY1 e5zcpZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |
8GCQ | Download | Experimental | e8gcqA1 e8gcqD1 e8gcqL1 e8gcqM1 e8gcqN1 e8gcqQ1 e8gcqY1 e8gcqZ1 | Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) Cytochrome c oxidase subunit I-like Mitochondrial cytochrome c oxidase subunit IV Mitochondrial cytochrome c oxidase subunit VIIc (aka VIIIa) Mitochondrial cytochrome c oxidase subunit VIIIb (aka IX) | LigPlot |