PDB ligand accession: X9H
DrugBank: DB18763
PubChem:
ChEMBL:
InChI Key: MKCYPWYURWOKST-INIZCTEOSA-N
SMILES: CC1=CC(Cn2c1c(c3c2ncnc3N)c4cc5ccccc5nc4)NC(=O)C=C
Drug action: n/a
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 8F1H | Download | Experimental | e8f1hA1 | Protein kinase/SAICAR synthase/ATP-grasp | LigPlot |