PDB ligand accession: 90D
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: ZTHQDSYJEPZECE-HLADLETHSA-N
SMILES: CCc1cccc(c1)c2c(cccc2F)C(CCCNC(=O)OC)(C3CCCN(C3)C(=O)CCCNC)O
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Biphenyls and derivatives
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
5V8V | Download | Experimental | e5v8vA1 e5v8vA2 e5v8vB1 e5v8vA1 e5v8vA2 e5v8vB1 e5v8vB2 | cradle loop barrel cradle loop barrel cradle loop barrel cradle loop barrel cradle loop barrel cradle loop barrel cradle loop barrel | LigPlot |