Ligand name: Trans-Geranyl BACTERIOCHLOROPHYLL A
PDB ligand accession: 07D
DrugBank: n/a
PubChem: n/a
ChEMBL: n/a
InChI Key: ZBSZXIUSELHDGQ-POZHEDQMSA-M
SMILES: CCc1c(c2n3c1C=C4C(=C5C(=O)C(C6=C7C(=C(C8=CC9=[N]([Mg]3(N87)[N]4=C65)C(=C2)C(=C9C)C(=O)C)C)CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(=O)OC)C)C
Drug action: n/a

List of PDB structures and/or AlphaFold models with target protein P02947

PDB/AF Accession	PyMOL script	Experimental / Predicted	Interacting ECOD domains	ECOD X-group name	LigPlot
7EQD	Download	Experimental	e7eqdA1 e7eqdB1 e7eqd91 e7eqd01 e7eqdA1 e7eqdB1 e7eqdD1 e7eqdE1 e7eqdD1 e7eqdF1 e7eqdE1 e7eqdG1 e7eqdF1 e7eqdI1 e7eqdG1 e7eqdJ1 e7eqdI1 e7eqdK1 e7eqdJ1 e7eqdN1 e7eqdK1 e7eqdO1 e7eqdN1 e7eqdP1 e7eqdO1 e7eqdQ1 e7eqdP1 e7eqdR1 e7eqdQ1 e7eqdS1 e7eqdR1 e7eqdT1 e7eqdS1 e7eqdU1 e7eqdT1 e7eqdV1 e7eqdU1 e7eqdW1 e7eqdV1 e7eqdX1 e7eqdW1 e7eqdY1 e7eqdX1 e7eqdZ1 e7eqdY1 e7eqd11 e7eqdZ1 e7eqd21 e7eqd11 e7eqd31 e7eqd21 e7eqd41 e7eqd31 e7eqd51 e7eqd41 e7eqd61 e7eqd51 e7eqd71 e7eqd61 e7eqd81 e7eqd71 e7eqd91 e7eqd81 e7eqd01	Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot