PDB ligand accession: SPO
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: FJOCMTHZSURUFA-KXCOHNEYSA-N
SMILES: CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=CCC(C)(C)OC)C)C)C)C
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Tetraterpenoids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 8B64 | Download | Experimental | e8b64d1 e8b64D1 e8b64B1 e8b64a1 e8b64b1 e8b64d1 e8b64A1 e8b64B1 e8b64a1 e8b64b1 e8b64A1 e8b64f1 e8b64E1 e8b64F1 e8b64j1 e8b64M1 e8b64e1 e8b64b1 e8b64d1 e8b64D1 e8b64B1 e8b64a1 e8b64b1 e8b64A1 e8b64B1 e8b64t1 e8b64u1 e8b64T1 e8b64s1 e8b64S1 e8b64R1 e8b64s1 e8b64r1 e8b64o1 e8b64R1 e8b64o1 e8b64O1 e8b64N1 e8b64r1 e8b64O1 e8b64R1 e8b64r1 e8b64o1 e8b64n1 e8b64O1 e8b64k1 e8b64K1 e8b64J1 e8b64o1 e8b64n1 e8b64k1 e8b64K1 e8b64N1 e8b64n1 e8b64k1 e8b64j1 e8b64K1 e8b64J1 e8b64k1 e8b64j1 e8b64i1 e8b64J1 e8b64i1 e8b64I1 e8b64G1 e8b64j1 e8b64I1 e8b64J1 e8b64j1 e8b64i1 e8b64g1 e8b64I1 e8b64g1 e8b64F1 e8b64G1 e8b64i1 e8b64g1 e8b64f1 e8b64G1 e8b64e1 e8b64g1 e8b64f1 e8b64E1 e8b64F1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 7YML | Download | Experimental | e7ymlM1 e7ymlV1 e7ymlD1 e7ymlF1 e7ymlI1 e7ymlE1 e7ymlG1 e7ymlD1 e7ymlB1 e7ymlE1 e7ymlF1 e7ymlE1 e7ymlG1 e7ymlF1 e7ymlI1 e7ymlG1 e7ymlJ1 e7ymlI1 e7ymlK1 e7ymlO1 e7ymlJ1 e7ymlN1 e7ymlK1 e7ymlJ1 e7ymlN1 e7ymlO1 e7ymlQ1 e7ymlS1 e7ymlP1 e7ymlR1 e7ymlO1 e7ymlN1 e7ymlP1 e7ymlQ1 e7ymlP1 e7ymlR1 e7ymlS1 e7ymlV1 e7ymlY1 e7ymlW1 e7ymlQ1 e7ymlS1 e7ymlR1 e7ymlT1 e7ymlS1 e7ymlV1 e7ymlT1 e7ymlW1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |