PDB ligand accession: U10
DrugBank: DB09270
PubChem:
ChEMBL:
InChI Key: ACTIUHUUMQJHFO-UPTCCGCDSA-N
SMILES: CC1=C(C(=O)C(=C(C1=O)OC)OC)CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Quinone and hydroquinone lipids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 8B64 | Download | Experimental | e8b64b1 e8b64L1 e8b64M1 | Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like | LigPlot |
| 7YML | Download | Experimental | e7ymlL1 e7ymlA1 e7ymlD1 e7ymlL1 e7ymlM1 e7ymlF1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits | LigPlot |