PDB ligand accession: TRT
DrugBank: DB02080
PubChem:
ChEMBL: n/a
InChI Key: HEUDUECKTWTQQR-UHFFFAOYSA-N
SMILES: CC(C)(C)CC(C)(C)c1ccc(cc1)OCCOCCOCCOC
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Phenylpropanes
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 7PZN | Download | Experimental | e7pznB1 e7pznA1 e7pznC1 e7pznD1 | Hepatitis B viral capsid (hbcag) Hepatitis B viral capsid (hbcag) Hepatitis B viral capsid (hbcag) Hepatitis B viral capsid (hbcag) | LigPlot |
| 7PZM | Download | Experimental | e7pzmB1 e7pzmA1 e7pzmC1 e7pzmD1 | Hepatitis B viral capsid (hbcag) Hepatitis B viral capsid (hbcag) Hepatitis B viral capsid (hbcag) Hepatitis B viral capsid (hbcag) | LigPlot |
| 7PZK | Download | Experimental | e7pzkB1 e7pzkA1 e7pzkC1 e7pzkD1 | Hepatitis B viral capsid (hbcag) Hepatitis B viral capsid (hbcag) Hepatitis B viral capsid (hbcag) Hepatitis B viral capsid (hbcag) | LigPlot |
| 7PZI | Download | Experimental | e7pziB1 e7pziA1 e7pziC1 e7pziD1 | Hepatitis B viral capsid (hbcag) Hepatitis B viral capsid (hbcag) Hepatitis B viral capsid (hbcag) Hepatitis B viral capsid (hbcag) | LigPlot |
| 7PZL | Download | Experimental | e7pzlA1 e7pzlB1 e7pzlC1 e7pzlD1 | Hepatitis B viral capsid (hbcag) Hepatitis B viral capsid (hbcag) Hepatitis B viral capsid (hbcag) Hepatitis B viral capsid (hbcag) | LigPlot |