Ligand name: Heteroaryldihydropyrimidine tetramethylrodamine
PDB ligand accession: E9D
DrugBank: n/a
PubChem: 163183784
ChEMBL: n/a
InChI Key: PZTNESDVJNEZKJ-UHFFFAOYSA-N
SMILES: CN(C)c1ccc2c(c1)OC3=CC(=[N+](C)C)C=CC3=C2c4cc(ccc4C(=O)[O-])C(=O)NCCCC(=O)N5CCN(CC5)Cc6c(c(nc(n6)c7ccccn7)c8ccc(cc8Cl)F)C(=O)OC
Drug action: n/a

List of PDB structures and/or AlphaFold models with target protein P03147

PDB/AF Accession	PyMOL script	Experimental / Predicted	Interacting ECOD domains	ECOD X-group name	LigPlot
6BVF	Download	Experimental	e6bvfB1 e6bvfC1 e6bvfC1	Hepatitis B viral capsid (hbcag) Hepatitis B viral capsid (hbcag) Hepatitis B viral capsid (hbcag)	LigPlot
6BVN	Download	Experimental	e6bvnC1 e6bvnB1	Hepatitis B viral capsid (hbcag) Hepatitis B viral capsid (hbcag)	LigPlot