Ligand name: all-trans-1,2-dihydroneurosporene
PDB ligand accession: NS0
DrugBank: n/a
PubChem: 5496946
ChEMBL: n/a
InChI Key: NHKJSVKSSGKUCH-XILUKMICSA-N
SMILES: CC(C)CCCC(=CCCC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C)C)C)C
Drug action: n/a

ClassyFire chemical classification:

• Kingdom: Organic compounds
  • Superclass: Lipids and lipid-like molecules
    • Class: Prenol lipids
      • Subclass: Tetraterpenoids

List of PDB structures and/or AlphaFold models with target protein P04124

PDB/AF Accession	PyMOL script	Experimental / Predicted	Interacting ECOD domains	ECOD X-group name	LigPlot
6ET5	Download	Experimental	e6et5z1 e6et511 e6et5w1 e6et531 e6et5F1 e6et5K1 e6et561 e6et5G1 e6et5F1 e6et5K1 e6et5P1 e6et5N1 e6et5K1 e6et5P1 e6et5S1 e6et5Q1 e6et5P1 e6et5S1 e6et5V1 e6et5T1 e6et5S1 e6et5V1 e6et5Y1 e6et5W1 e6et5L1 e6et5V1 e6et5Y1 e6et5b1 e6et5Z1 e6et5Y1 e6et5b1 e6et5e1 e6et5c1 e6et5b1 e6et5e1 e6et5h1 e6et5f1 e6et5M1 e6et5e1 e6et5h1 e6et5k1 e6et5i1 e6et5h1 e6et5k1 e6et5n1 e6et5l1 e6et5k1 e6et5n1 e6et5q1 e6et5o1 e6et5n1 e6et5q1 e6et5t1 e6et5r1 e6et5q1 e6et5t1 e6et5w1 e6et5u1 e6et5z1 e6et5t1 e6et5w1 e6et5x1 e6et5z1 e6et531 e6et561 e6et541 e6et531 e6et561 e6et571	Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot