Ligand name: all-trans-1,2-dihydroneurosporene
PDB ligand accession: NS0
DrugBank: n/a
PubChem: 5496946
ChEMBL: n/a
InChI Key: NHKJSVKSSGKUCH-XILUKMICSA-N
SMILES: CC(C)CCCC(=CCCC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C)C)C)C
Drug action: n/a

ClassyFire chemical classification: No PTM data available

List of PDB structures and/or AlphaFold models with target protein P04124

PDB/AF Accession PyMOL script Experimental / Predicted Interacting ECOD domains ECOD X-group name LigPlot
6ET5 Download Experimental e6et5z1
e6et511
e6et5w1
e6et531
e6et5F1
e6et5K1
e6et561
e6et5G1
e6et5F1
e6et5K1
e6et5P1
e6et5N1
e6et5K1
e6et5P1
e6et5S1
e6et5Q1
e6et5P1
e6et5S1
e6et5V1
e6et5T1
e6et5S1
e6et5V1
e6et5Y1
e6et5W1
e6et5L1
e6et5V1
e6et5Y1
e6et5b1
e6et5Z1
e6et5Y1
e6et5b1
e6et5e1
e6et5c1
e6et5b1
e6et5e1
e6et5h1
e6et5f1
e6et5M1
e6et5e1
e6et5h1
e6et5k1
e6et5i1
e6et5h1
e6et5k1
e6et5n1
e6et5l1
e6et5k1
e6et5n1
e6et5q1
e6et5o1
e6et5n1
e6et5q1
e6et5t1
e6et5r1
e6et5q1
e6et5t1
e6et5w1
e6et5u1
e6et5z1
e6et5t1
e6et5w1
e6et5x1
e6et5z1
e6et531
e6et561
e6et541
e6et531
e6et561
e6et571
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial photosystem II reaction centre L and M subunits-like
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial photosystem II reaction centre L and M subunits-like
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
LigPlot