PDB ligand accession: SMA
DrugBank: n/a
PubChem: n/a
ChEMBL: n/a
InChI Key: UZHDGDDPOPDJGM-WPPYOTIYSA-N
SMILES: CC=C(C)C=CC=CC(C(C)C(C(C)CCC1=C(C(=O)c2c(cc(c(c2O1)O)OC)OC)C)OC)OC
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Benzopyrans
- Subclass: 1-benzopyrans
- Class: Benzopyrans
- Superclass: Organoheterocyclic compounds
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 3CXH | Download | Experimental | e3cxhP1 e3cxhC1 e3cxhC2 e3cxhP3 e3cxhE1 e3cxhN1 e3cxhN2 e3cxhE3 | ISP domain a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle Trm112p-like ISP domain a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle Trm112p-like | LigPlot |
| 1KYO | Download | Experimental | e1kyoC1 e1kyoC2 e1kyoP3 e1kyoE1 e1kyoN1 e1kyoN2 e1kyoE3 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle Trm112p-like ISP domain a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle Trm112p-like | LigPlot |
| 3CX5 | Download | Experimental | e3cx5P1 e3cx5C1 e3cx5C2 e3cx5P3 e3cx5E1 e3cx5N1 e3cx5N2 e3cx5E3 | ISP domain a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle Trm112p-like ISP domain a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle Trm112p-like | LigPlot |