PDB ligand accession: OPC
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: CTQFGTDUPDRLRZ-CNMUNUSJSA-O
SMILES: CCCCCCCCCC=CCCCCCCC(=O)OCC(C)(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCC=CCCCCCCCCC
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Glycerophospholipids
- Subclass: Glycerophosphocholines
- Class: Glycerophospholipids
- Superclass: Lipids and lipid-like molecules
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 2ZT9 | Download | Experimental | e2zt9A1 e2zt9B1 e2zt9C1 e2zt9E1 e2zt9F1 e2zt9G1 e2zt9H1 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Immunoglobulin-like beta-sandwich PetL subunit of the cytochrome b6f complex PetM subunit of the cytochrome b6f complex PetG subunit of the cytochrome b6f complex PetN subunit of the cytochrome b6f complex | LigPlot |
| 4H44 | Download | Experimental | e4h44C4 e4h44A1 e4h44B1 e4h44E1 e4h44F1 e4h44H1 e4h44G1 | Immunoglobulin-like beta-sandwich Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetL subunit of the cytochrome b6f complex PetM subunit of the cytochrome b6f complex PetN subunit of the cytochrome b6f complex PetG subunit of the cytochrome b6f complex | LigPlot |