Ligand name: BACTERIOCHLOROPHYLL A
PDB ligand accession: BCL
DrugBank: DB01853
PubChem: 11953947;16057436;
ChEMBL: n/a
InChI Key: DSJXIQQMORJERS-AGGZHOMASA-M
SMILES: CCC1C(C2=CC3=C(C(=C4[N-]3[Mg+2]56[N]2=C1C=C7[N-]5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C(=O)C)C
Drug action: n/a

ClassyFire chemical classification:

• Kingdom: Organic compounds
  • Superclass: Organoheterocyclic compounds
    • Class: Tetrapyrroles and derivatives
      • Subclass: Metallotetrapyrroles

List of PDB structures and/or AlphaFold models with target protein P0C0X9

PDB/AF Accession	PyMOL script	Experimental / Predicted	Interacting ECOD domains	ECOD X-group name	LigPlot
7F0L	Download	Experimental	e7f0l41 e7f0l51 e7f0l41 e7f0l61 e7f0l51 e7f0l61 e7f0l51 e7f0l71 e7f0l61 e7f0l81 e7f0l51 e7f0l71 e7f0l81 e7f0l71	Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot
4V9G	Download	Experimental	e4v9gAT1 e4v9gAU1 e4v9gAT1 e4v9gAV1 e4v9gAW1 e4v9gA31 e4v9gA41 e4v9gA51 e4v9gA71 e4v9gA81 e4v9gAD1 e4v9gAE1 e4v9gAD1 e4v9gAF1 e4v9gAG1 e4v9gA11 e4v9gAI1 e4v9gAJ1 e4v9gA21 e4v9gA91 e4v9gAK1 e4v9gAJ1 e4v9gA21 e4v9gA91 e4v9gAN1 e4v9gAO1 e4v9gAP1 e4v9gAZ1 e4v9gAQ1 e4v9gAP1 e4v9gAZ1 e4v9gAS1 e4v9gAT1 e4v9gAZ1 e4v9gAS1 e4v9gA21 e4v9gAN1 e4v9gA91 e4v9gAN1 e4v9gAP1 e4v9gAO1 e4v9gAQ1 e4v9gA51 e4v9gA71 e4v9gA61 e4v9gBB1 e4v9gAV1 e4v9gAX1 e4v9gAW1 e4v9gAX1 e4v9gA31 e4v9gAY1 e4v9gA71 e4v9gAD1 e4v9gA81 e4v9gAF1 e4v9gAG1 e4v9gA11 e4v9gAJ1 e4v9gAK1 e4v9gB51 e4v9gB61 e4v9gBT1 e4v9gBU1 e4v9gBV1 e4v9gBX1 e4v9gBW1 e4v9gB31 e4v9gB41 e4v9gB51 e4v9gB71 e4v9gB81 e4v9gBD1 e4v9gBE1 e4v9gBF1 e4v9gBG1 e4v9gBF1 e4v9gB11 e4v9gBI1 e4v9gBJ1 e4v9gB21 e4v9gB91 e4v9gBP1 e4v9gBZ1 e4v9gBQ1 e4v9gBT1 e4v9gBZ1 e4v9gBS1 e4v9gB21 e4v9gBN1 e4v9gB91 e4v9gBN1 e4v9gBP1 e4v9gBO1 e4v9gBQ1 e4v9gB51 e4v9gB71 e4v9gB61 e4v9gAB1 e4v9gBX1 e4v9gB31 e4v9gBY1 e4v9gB71 e4v9gBD1 e4v9gB81 e4v9gB11 e4v9gBI1 e4v9gBJ1 e4v9gB21 e4v9gB91 e4v9gBK1	Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot