PDB ligand accession: HEM
DrugBank: DB18267
PubChem: n/a
ChEMBL: n/a
InChI Key: KABFMIBPWCXCRK-RGGAHWMASA-L
SMILES: Cc1c2n3c(c1CCC(=O)O)C=C4C(=C(C5=[N]4[Fe]36[N]7=C(C=C8N6C(=C5)C(=C8C)C=C)C(=C(C7=C2)C)C=C)C)CCC(=O)O
Drug action: n/a
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 7RJC | Download | Experimental | e7rjcK1 e7rjcK2 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) | LigPlot |
| 7RJA | Download | Experimental | e7rjaK1 e7rjaK2 e7rjaT1 e7rjaT2 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) | LigPlot |
| 7RJE | Download | Experimental | e7rjeK1 e7rjeK2 e7rjeT1 e7rjeT2 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) | LigPlot |
| 7RJD | Download | Experimental | e7rjdK1 e7rjdK2 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) | LigPlot |
| 7RJB | Download | Experimental | e7rjbK1 e7rjbK2 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) | LigPlot |