PDB ligand accession: BCL
DrugBank: DB01853
PubChem: 11953947;16057436;
ChEMBL: n/a
InChI Key: DSJXIQQMORJERS-AGGZHOMASA-M
SMILES: CCC1C(C2=CC3=C(C(=C4[N-]3[Mg+2]56[N]2=C1C=C7[N-]5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C(=O)C)C
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Tetrapyrroles and derivatives
- Subclass: Metallotetrapyrroles
- Class: Tetrapyrroles and derivatives
- Superclass: Organoheterocyclic compounds
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 7VNM | Download | Experimental | e7vnm71 e7vnm81 e7vnmX1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX | LigPlot |
| 7VNY | Download | Experimental | e7vny71 e7vny81 e7vnyX1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX | LigPlot |
| 7PIL | Download | Experimental | e7pilAA1 e7pilBA1 e7pilX1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX | LigPlot |
| 7VB9 | Download | Experimental | e7vb971 e7vb961 e7vb981 e7vb9C1 e7vb971 e7vb961 e7vb9aa1 e7vb9c1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX | LigPlot |
| 4V9G | Download | Experimental | e4v9gA51 e4v9gA71 e4v9gA61 e4v9gBB1 e4v9gB51 e4v9gB71 e4v9gB61 e4v9gAB1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX | LigPlot |
| 7VA9 | Download | Experimental | e7va971 e7va961 e7va981 e7va9C1 e7va971 e7va961 e7va9aa1 e7va9c1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX | LigPlot |
| 7VOT | Download | Experimental | e7vot71 e7vot81 e7votX1 e7vot61 e7votb81 e7votx1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX | LigPlot |