PDB ligand accession: H8G
DrugBank: DB00589
InChI Key: BKRGVLQUQGGVSM-KBXCAEBGSA-N
SMILES: CCN(CC)C(=O)NC1CN(C2Cc3c[nH]c4c3c(ccc4)C2=C1)C
Drug action: agonist
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Quinolines and derivatives
- Subclass: Indoloquinolines
- Class: Quinolines and derivatives
- Superclass: Organoheterocyclic compounds
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name |
|---|---|---|---|---|
| P14416 | Download | Predicted | P14416_F1_nD1 | Family A G protein-coupled receptor-like |
| 5AER | Predicted | |||
| 6CM4 | Predicted | |||
| 6LUQ | Predicted | |||
| 6VMS | Predicted | |||
| 7DFP | Predicted | |||
| 7JVR | Predicted |