PDB ligand accession: HEM
DrugBank: DB18267
PubChem: n/a
ChEMBL: n/a
InChI Key: KABFMIBPWCXCRK-RGGAHWMASA-L
SMILES: Cc1c2n3c(c1CCC(=O)O)C=C4C(=C(C5=[N]4[Fe]36[N]7=C(C=C8N6C(=C5)C(=C8C)C=C)C(=C(C7=C2)C)C=C)C)CCC(=O)O
Drug action: n/a
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 3H1L | Download | Experimental | e3h1lC1 e3h1lC2 e3h1lP1 e3h1lP2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 3CWB | Download | Experimental | e3cwbC1 e3cwbC2 e3cwbP1 e3cwbP2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 3L74 | Download | Experimental | e3l74C1 e3l74C2 e3l74P1 e3l74P2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 3L72 | Download | Experimental | e3l72C1 e3l72C2 e3l72P1 e3l72P2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 4U3F | Download | Experimental | e4u3fC1 e4u3fC2 e4u3fP1 e4u3fP2 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 3L70 | Download | Experimental | e3l70C1 e3l70C2 e3l70P1 e3l70P2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 3L71 | Download | Experimental | e3l71C1 e3l71C2 e3l71P1 e3l71P2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 3TGU | Download | Experimental | e3tguC1 e3tguC2 e3tguP1 e3tguP2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 3BCC | Download | Experimental | e3bccC2 | Transmembrane heme-binding four-helical bundle | LigPlot |
| 1BCC | Download | Experimental | e1bccC1 e1bccC2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 3L73 | Download | Experimental | e3l73C1 e3l73C2 e3l73P1 e3l73P2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 3H1I | Download | Experimental | e3h1iC2 e3h1iP2 | Transmembrane heme-binding four-helical bundle Transmembrane heme-binding four-helical bundle | LigPlot |
| 3H1J | Download | Experimental | e3h1jC1 e3h1jC2 e3h1jP1 e3h1jP2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 3L75 | Download | Experimental | e3l75C1 e3l75C2 e3l75P1 e3l75P2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 2BCC | Download | Experimental | e2bccC1 e2bccC2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 3H1H | Download | Experimental | e3h1hC1 e3h1hC2 e3h1hP1 e3h1hP2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 3H1K | Download | Experimental | e3h1kC1 e3h1kC2 e3h1kP1 e3h1kP2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |