PDB ligand accession: RG1
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: ISHBHDBCVQRMDY-GZIKAPSJSA-N
SMILES: CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCCC(C)(C)OC1C(C(C(C(O1)CO)O)O)O)C)C)C)C
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Tetraterpenoids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 1KZU | Download | Experimental | e1kzuA1 e1kzuB1 e1kzuD1 e1kzuA1 e1kzuB1 e1kzuD1 e1kzuB1 e1kzuE1 e1kzuD1 e1kzuA1 e1kzuG1 e1kzuB1 e1kzuE1 e1kzuG1 e1kzuH1 e1kzuE1 e1kzuD1 e1kzuG1 e1kzuH1 e1kzuE1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 1NKZ | Download | Experimental | e1nkzA1 e1nkzB1 e1nkzA1 e1nkzB1 e1nkzC1 e1nkzB1 e1nkzC1 e1nkzD1 e1nkzA1 e1nkzB1 e1nkzC1 e1nkzE1 e1nkzD1 e1nkzE1 e1nkzF1 e1nkzD1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 2FKW | Download | Experimental | e2fkwC1 e2fkwA1 e2fkwE1 e2fkwB1 e2fkwD1 e2fkwC1 e2fkwG1 e2fkwE1 e2fkwF1 e2fkwD1 e2fkwG1 e2fkwE1 e2fkwI1 e2fkwF1 e2fkwH1 e2fkwG1 e2fkwK1 e2fkwI1 e2fkwH1 e2fkwJ1 e2fkwM1 e2fkwK1 e2fkwI1 e2fkwJ1 e2fkwL1 e2fkwM1 e2fkwO1 e2fkwK1 e2fkwN1 e2fkwL1 e2fkwM1 e2fkwO1 e2fkwR1 e2fkwN1 e2fkwP1 e2fkwC1 e2fkwA1 e2fkwR1 e2fkwS1 e2fkwB1 e2fkwA1 e2fkwO1 e2fkwR1 e2fkwS1 e2fkwP1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |