PDB ligand accession: 49W
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: BUOYUEMVUCMLPE-LQJZCPKCSA-N
SMILES: CCCN(CCC)C(=O)c1cc(cc(c1)N2CC=CC=C2)C(=O)NC(Cc3ccccc3)C(CNC(C)(C)c4ccccn4)O
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Phenylbutylamines
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 4YA8 | Download | Experimental | e4ya8A1 e4ya8A2 e4ya8B1 e4ya8B2 e4ya8C1 e4ya8C2 e4ya8D1 | cradle loop barrel cradle loop barrel cradle loop barrel cradle loop barrel cradle loop barrel cradle loop barrel cradle loop barrel | LigPlot |