PDB ligand accession: 1BL
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: ZQBAKJWCBZPMKW-OYUWMTPXSA-N
SMILES: CC(C)(C)c1cccc(c1)C2(CCCCC2)NCC(C(Cc3cc(cc(c3)F)F)NC(=O)CCC(C(=O)O)O)O
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Phenylbutylamines
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 4I0H | Download | Experimental | e4i0hA2 e4i0hA3 e4i0hB2 e4i0hB3 e4i0hC2 e4i0hC3 | cradle loop barrel cradle loop barrel cradle loop barrel cradle loop barrel cradle loop barrel cradle loop barrel | LigPlot |