PDB ligand accession: CLA
DrugBank: DB02133
PubChem: 12085802;13557925;16667503;44602414;
ChEMBL: n/a
InChI Key: ATNHDLDRLWWWCB-AENOIHSZSA-M
SMILES: CCC1=C(C2=Cc3c(c(c4n3[Mg]56[N]2=C1C=C7N5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C=C)C
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Tetrapyrroles and derivatives
- Subclass: Chlorins
- Class: Tetrapyrroles and derivatives
- Superclass: Organoheterocyclic compounds
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 6NWA | Download | Experimental | e6nwaa1 e6nwak1 e6nwaA2 e6nwaK1 e6nwaH2 e6nwaT1 | Bacterial photosystem II reaction centre L and M subunits-like Photosystem I reaction center subunit X, PsaK Bacterial photosystem II reaction centre L and M subunits-like Photosystem I reaction center subunit X, PsaK Bacterial photosystem II reaction centre L and M subunits-like Photosystem I reaction center subunit X, PsaK | LigPlot |
| 7UMH | Download | Experimental | e7umhA2 e7umhK1 e7umhH2 e7umhT1 e7umha1 e7umhk1 | Bacterial photosystem II reaction centre L and M subunits-like Photosystem I reaction center subunit X, PsaK Bacterial photosystem II reaction centre L and M subunits-like Photosystem I reaction center subunit X, PsaK Bacterial photosystem II reaction centre L and M subunits-like Photosystem I reaction center subunit X, PsaK | LigPlot |
| 8AM5 | Download | Experimental | e8am5a1 e8am5k1 e8am5k1 | Bacterial photosystem II reaction centre L and M subunits-like Photosystem I reaction center subunit X, PsaK Photosystem I reaction center subunit X, PsaK | LigPlot |
| 8ASP | Download | Experimental | e8aspk1 | Photosystem I reaction center subunit X, PsaK | LigPlot |
| 8ASL | Download | Experimental | e8asla2 e8aslk1 e8aslk1 | Bacterial photosystem II reaction centre L and M subunits-like Photosystem I reaction center subunit X, PsaK Photosystem I reaction center subunit X, PsaK | LigPlot |