PDB ligand accession: HEC
DrugBank: DB03317
PubChem: n/a
ChEMBL: n/a
InChI Key: HXQIYSLZKNYNMH-LJNAALQVSA-N
SMILES: CC=C1C(=C2C=C3C(=CC)C(=C4N3[Fe]56N2C1=Cc7n5c(c(c7C)CCC(=O)O)C=C8N6C(=C4)C(=C8CCC(=O)O)C)C)C
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Tetrapyrroles and derivatives
- Subclass: Metallotetrapyrroles
- Class: Tetrapyrroles and derivatives
- Superclass: Organoheterocyclic compounds
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
7ZXY | Download | Experimental | e7zxyA1 e7zxyB1 e7zxyH1 e7zxyI1 e7zxyJ1 e7zxyP1 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetN subunit of the cytochrome b6f complex Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetN subunit of the cytochrome b6f complex | LigPlot |