PDB ligand accession: OZ2
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: YOPHQENQMRACBJ-BMAOJOIDSA-N
SMILES: CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(CO)O)OC(=O)CCCCC=CCCCCCC
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Glycerophospholipids
- Subclass: Glycerophosphoglycerols
- Class: Glycerophospholipids
- Superclass: Lipids and lipid-like molecules
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
4I7Z | Download | Experimental | e4i7zA1 e4i7zB1 e4i7zA1 e4i7zB1 e4i7zC2 e4i7zD1 e4i7zA1 e4i7zB1 e4i7zE1 e4i7zF1 e4i7zH1 e4i7zC1 e4i7zG1 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Cytochrome f subunit of the cytochrome b6f complex, transmembrane anchor iron-sulfur subunit (ISP) transmembrane anchor Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetL subunit of the cytochrome b6f complex PetM subunit of the cytochrome b6f complex PetN subunit of the cytochrome b6f complex Immunoglobulin-like beta-sandwich PetG subunit of the cytochrome b6f complex | LigPlot |