PDB ligand accession: HEM
DrugBank: DB18267
PubChem: n/a
ChEMBL: n/a
InChI Key: KABFMIBPWCXCRK-RGGAHWMASA-L
SMILES: Cc1c2n3c(c1CCC(=O)O)C=C4C(=C(C5=[N]4[Fe]36[N]7=C(C=C8N6C(=C5)C(=C8C)C=C)C(=C(C7=C2)C)C=C)C)CCC(=O)O
Drug action: n/a
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 4I7Z | Download | Experimental | e4i7zA1 e4i7zB1 e4i7zH1 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetN subunit of the cytochrome b6f complex | LigPlot |
| 4H13 | Download | Experimental | e4h13A1 e4h13B1 e4h13H1 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetN subunit of the cytochrome b6f complex | LigPlot |
| 2E74 | Download | Experimental | e2e74B1 e2e74A1 e2e74H1 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle PetN subunit of the cytochrome b6f complex | LigPlot |
| 2E75 | Download | Experimental | e2e75B2 e2e75A1 e2e75H1 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle PetN subunit of the cytochrome b6f complex | LigPlot |
| 2E76 | Download | Experimental | e2e76B1 e2e76A1 e2e76H1 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle PetN subunit of the cytochrome b6f complex | LigPlot |
| 2D2C | Download | Experimental | e2d2cB1 e2d2cA1 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 1VF5 | Download | Experimental | e1vf5B1 e1vf5A1 e1vf5O1 e1vf5N1 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 4H0L | Download | Experimental | e4h0lA2 e4h0lB1 e4h0lH1 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetN subunit of the cytochrome b6f complex | LigPlot |