PDB ligand accession: OPC
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: CTQFGTDUPDRLRZ-CNMUNUSJSA-O
SMILES: CCCCCCCCCC=CCCCCCCC(=O)OCC(C)(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCC=CCCCCCCCCC
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Glycerophospholipids
- Subclass: Glycerophosphocholines
- Class: Glycerophospholipids
- Superclass: Lipids and lipid-like molecules
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
2D2C | Download | Experimental | e2d2cC2 e2d2cB1 e2d2cD2 e2d2cP2 e2d2cO1 e2d2cN1 e2d2cQ2 | Cytochrome f subunit of the cytochrome b6f complex, transmembrane anchor a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) iron-sulfur subunit (ISP) transmembrane anchor Cytochrome f subunit of the cytochrome b6f complex, transmembrane anchor a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle iron-sulfur subunit (ISP) transmembrane anchor | LigPlot |
4PV1 | Download | Experimental | e4pv1A1 e4pv1B1 e4pv1E1 e4pv1F1 e4pv1G1 e4pv1H1 e4pv1C2 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetL subunit of the cytochrome b6f complex PetM subunit of the cytochrome b6f complex PetG subunit of the cytochrome b6f complex PetN subunit of the cytochrome b6f complex Immunoglobulin-like beta-sandwich | LigPlot |
2E75 | Download | Experimental | e2e75B2 e2e75C1 e2e75G1 e2e75A1 e2e75E1 e2e75F1 e2e75H1 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Immunoglobulin-like beta-sandwich PetG subunit of the cytochrome b6f complex Transmembrane heme-binding four-helical bundle PetL subunit of the cytochrome b6f complex PetM subunit of the cytochrome b6f complex PetN subunit of the cytochrome b6f complex | LigPlot |
2E76 | Download | Experimental | e2e76C1 e2e76G1 e2e76B1 e2e76A1 e2e76E1 e2e76F1 e2e76H1 | Immunoglobulin-like beta-sandwich PetG subunit of the cytochrome b6f complex a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle PetL subunit of the cytochrome b6f complex PetM subunit of the cytochrome b6f complex PetN subunit of the cytochrome b6f complex | LigPlot |
1VF5 | Download | Experimental | e1vf5D5 e1vf5B1 e1vf5A1 e1vf5C2 e1vf5Q5 e1vf5P1 e1vf5O1 e1vf5N1 e1vf5P2 | iron-sulfur subunit (ISP) transmembrane anchor a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle Cytochrome f subunit of the cytochrome b6f complex, transmembrane anchor iron-sulfur subunit (ISP) transmembrane anchor Immunoglobulin-like beta-sandwich a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle Cytochrome f subunit of the cytochrome b6f complex, transmembrane anchor | LigPlot |
4H0L | Download | Experimental | e4h0lA2 e4h0lG1 e4h0lB1 e4h0lE1 e4h0lF1 e4h0lH1 e4h0lC1 | Transmembrane heme-binding four-helical bundle PetG subunit of the cytochrome b6f complex a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetL subunit of the cytochrome b6f complex PetM subunit of the cytochrome b6f complex PetN subunit of the cytochrome b6f complex Immunoglobulin-like beta-sandwich | LigPlot |
4H13 | Download | Experimental | e4h13A1 e4h13C1 e4h13B1 e4h13G1 e4h13H1 e4h13F1 e4h13E1 | Transmembrane heme-binding four-helical bundle Immunoglobulin-like beta-sandwich a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetG subunit of the cytochrome b6f complex PetN subunit of the cytochrome b6f complex PetM subunit of the cytochrome b6f complex PetL subunit of the cytochrome b6f complex | LigPlot |
2E74 | Download | Experimental | e2e74C1 e2e74G1 e2e74E1 e2e74F1 e2e74B1 e2e74A1 e2e74H1 | Immunoglobulin-like beta-sandwich PetG subunit of the cytochrome b6f complex PetL subunit of the cytochrome b6f complex PetM subunit of the cytochrome b6f complex a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle PetN subunit of the cytochrome b6f complex | LigPlot |