PDB ligand accession: BCR
DrugBank: DB06755
PubChem:
ChEMBL:
InChI Key: OENHQHLEOONYIE-JLTXGRSLSA-N
SMILES: CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2=C(CCCC2(C)C)C)C)C
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Tetraterpenoids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 2E74 | Download | Experimental | e2e74G1 e2e74F1 e2e74B1 e2e74A1 e2e74H1 | PetG subunit of the cytochrome b6f complex PetM subunit of the cytochrome b6f complex a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle PetN subunit of the cytochrome b6f complex | LigPlot |
| 4I7Z | Download | Experimental | e4i7zA1 e4i7zB1 e4i7zF1 e4i7zH1 e4i7zC2 e4i7zG1 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetM subunit of the cytochrome b6f complex PetN subunit of the cytochrome b6f complex Cytochrome f subunit of the cytochrome b6f complex, transmembrane anchor PetG subunit of the cytochrome b6f complex | LigPlot |
| 1VF5 | Download | Experimental | e1vf5B1 e1vf5A1 e1vf5E1 e1vf5F1 e1vf5O1 e1vf5N1 e1vf5R1 e1vf5S1 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle PetL subunit of the cytochrome b6f complex PetM subunit of the cytochrome b6f complex a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle PetL subunit of the cytochrome b6f complex PetM subunit of the cytochrome b6f complex | LigPlot |
| 4H13 | Download | Experimental | e4h13A1 e4h13C2 e4h13B1 e4h13G1 e4h13H1 e4h13F1 | Transmembrane heme-binding four-helical bundle Cytochrome f subunit of the cytochrome b6f complex, transmembrane anchor a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetG subunit of the cytochrome b6f complex PetN subunit of the cytochrome b6f complex PetM subunit of the cytochrome b6f complex | LigPlot |
| 4PV1 | Download | Experimental | e4pv1A1 e4pv1B1 e4pv1F1 e4pv1G1 e4pv1H1 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetM subunit of the cytochrome b6f complex PetG subunit of the cytochrome b6f complex PetN subunit of the cytochrome b6f complex | LigPlot |
| 4H0L | Download | Experimental | e4h0lA2 e4h0lG1 e4h0lB1 e4h0lF1 e4h0lH1 e4h0lC2 | Transmembrane heme-binding four-helical bundle PetG subunit of the cytochrome b6f complex a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetM subunit of the cytochrome b6f complex PetN subunit of the cytochrome b6f complex Cytochrome f subunit of the cytochrome b6f complex, transmembrane anchor | LigPlot |
| 2E75 | Download | Experimental | e2e75B2 e2e75G1 e2e75A1 e2e75F1 e2e75H1 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetG subunit of the cytochrome b6f complex Transmembrane heme-binding four-helical bundle PetM subunit of the cytochrome b6f complex PetN subunit of the cytochrome b6f complex | LigPlot |
| 2D2C | Download | Experimental | e2d2cF2 e2d2cB1 e2d2cA1 e2d2cE1 e2d2cS2 e2d2cO1 e2d2cN1 e2d2cR1 | PetM subunit of the cytochrome b6f complex a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle PetL subunit of the cytochrome b6f complex PetM subunit of the cytochrome b6f complex a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle PetL subunit of the cytochrome b6f complex | LigPlot |
| 2E76 | Download | Experimental | e2e76G1 e2e76B1 e2e76A1 e2e76F1 e2e76H1 | PetG subunit of the cytochrome b6f complex a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle PetM subunit of the cytochrome b6f complex PetN subunit of the cytochrome b6f complex | LigPlot |