Ligand name: (7R,17E)-4-HYDROXY-N,N,N,7-TETRAMETHYL-7-[(8E)-OCTADEC-8-ENOYLOXY]-10-OXO-3,5,9-TRIOXA-4-PHOSPHAHEPTACOS-17-EN-1-AMINIUM 4-OXIDE
PDB ligand accession: OPC
DrugBank: n/a
PubChem: 52944159
ChEMBL: n/a
InChI Key: CTQFGTDUPDRLRZ-CNMUNUSJSA-O
SMILES: CCCCCCCCCC=CCCCCCCC(=O)OCC(C)(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCC=CCCCCCCCCC
Drug action: n/a

ClassyFire chemical classification: No PTM data available

List of PDB structures and/or AlphaFold models with target protein P83797

PDB/AF Accession PyMOL script Experimental / Predicted Interacting ECOD domains ECOD X-group name LigPlot
4PV1 Download Experimental e4pv1A1
e4pv1B1
e4pv1E1
e4pv1F1
e4pv1G1
e4pv1H1
e4pv1C2
Transmembrane heme-binding four-helical bundle
a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase)
PetL subunit of the cytochrome b6f complex
PetM subunit of the cytochrome b6f complex
PetG subunit of the cytochrome b6f complex
PetN subunit of the cytochrome b6f complex
Immunoglobulin-like beta-sandwich
LigPlot
2E75 Download Experimental e2e75B2
e2e75C1
e2e75G1
e2e75A1
e2e75E1
e2e75F1
e2e75H1
a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase)
Immunoglobulin-like beta-sandwich
PetG subunit of the cytochrome b6f complex
Transmembrane heme-binding four-helical bundle
PetL subunit of the cytochrome b6f complex
PetM subunit of the cytochrome b6f complex
PetN subunit of the cytochrome b6f complex
LigPlot
2E76 Download Experimental e2e76C1
e2e76G1
e2e76B1
e2e76A1
e2e76E1
e2e76F1
e2e76H1
Immunoglobulin-like beta-sandwich
PetG subunit of the cytochrome b6f complex
a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase)
Transmembrane heme-binding four-helical bundle
PetL subunit of the cytochrome b6f complex
PetM subunit of the cytochrome b6f complex
PetN subunit of the cytochrome b6f complex
LigPlot
4H0L Download Experimental e4h0lA2
e4h0lG1
e4h0lB1
e4h0lE1
e4h0lF1
e4h0lH1
e4h0lC1
Transmembrane heme-binding four-helical bundle
PetG subunit of the cytochrome b6f complex
a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase)
PetL subunit of the cytochrome b6f complex
PetM subunit of the cytochrome b6f complex
PetN subunit of the cytochrome b6f complex
Immunoglobulin-like beta-sandwich
LigPlot
4H13 Download Experimental e4h13A1
e4h13C1
e4h13B1
e4h13G1
e4h13H1
e4h13F1
e4h13E1
Transmembrane heme-binding four-helical bundle
Immunoglobulin-like beta-sandwich
a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase)
PetG subunit of the cytochrome b6f complex
PetN subunit of the cytochrome b6f complex
PetM subunit of the cytochrome b6f complex
PetL subunit of the cytochrome b6f complex
LigPlot
2E74 Download Experimental e2e74C1
e2e74G1
e2e74E1
e2e74F1
e2e74B1
e2e74A1
e2e74H1
Immunoglobulin-like beta-sandwich
PetG subunit of the cytochrome b6f complex
PetL subunit of the cytochrome b6f complex
PetM subunit of the cytochrome b6f complex
a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase)
Transmembrane heme-binding four-helical bundle
PetN subunit of the cytochrome b6f complex
LigPlot