Ligand name: BACTERIOCHLOROPHYLL A
PDB ligand accession: BCL
DrugBank: DB01853
PubChem: 11953947;16057436;
ChEMBL: n/a
InChI Key: DSJXIQQMORJERS-AGGZHOMASA-M
SMILES: CCC1C(C2=CC3=C(C(=C4[N-]3[Mg+2]56[N]2=C1C=C7[N-]5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C(=O)C)C
Drug action: n/a

ClassyFire chemical classification:

• Kingdom: Organic compounds
  • Superclass: Organoheterocyclic compounds
    • Class: Tetrapyrroles and derivatives
      • Subclass: Metallotetrapyrroles

List of PDB structures and/or AlphaFold models with target protein P97253

PDB/AF Accession	PyMOL script	Experimental / Predicted	Interacting ECOD domains	ECOD X-group name	LigPlot
8FB9	Download	Experimental	e8fb9M1 e8fb9N1 e8fb9O1 e8fb9P1 e8fb9Q1 e8fb9R1 e8fb9S1 e8fb9T1 e8fb9U1 e8fb9V1 e8fb9W1 e8fb9X1 e8fb9Y1 e8fb9Z1 e8fb9a1 e8fb9b1	Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot
7TUW	Download	Experimental	e7tuwM1 e7tuwN1 e7tuwO1 e7tuwP1 e7tuwQ1 e7tuwR1 e7tuwS1 e7tuwT1 e7tuwU1 e7tuwV1 e7tuwW1 e7tuwX1 e7tuwY1 e7tuwZ1 e7tuwa1 e7tuwb1	Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot
1LGH	Download	Experimental	e1lghA1 e1lghB1 e1lghD1 e1lghE1 e1lghA1 e1lghB1 e1lghD1 e1lghD1 e1lghE1 e1lghJ1 e1lghG1 e1lghK1 e1lghH1 e1lghJ1 e1lghG1 e1lghH1 e1lghJ1 e1lghK1	Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot
8FBB	Download	Experimental	e8fbbg1 e8fbbB1 e8fbbC1 e8fbbF1 e8fbbD1 e8fbbE1 e8fbbG1 e8fbbH1 e8fbbI1 e8fbbJ1 e8fbbK1 e8fbbL1 e8fbbM1 e8fbbN1 e8fbbO1 e8fbbP1	Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot
7TV3	Download	Experimental	e7tv3A1 e7tv3B1 e7tv3C1 e7tv3F1 e7tv3D1 e7tv3E1 e7tv3G1 e7tv3H1 e7tv3I1 e7tv3J1 e7tv3K1 e7tv3L1 e7tv3M1 e7tv3N1 e7tv3O1 e7tv3P1	Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot