Ligand name: LYCOPENE
PDB ligand accession: LYC
DrugBank: DB11231
PubChem: 446925
ChEMBL: CHEMBL501174
InChI Key: OAIJSZIZWZSQBC-GYZMGTAESA-N
SMILES: CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C)C)C)C)C
Drug action: n/a

ClassyFire chemical classification: No PTM data available

List of PDB structures and/or AlphaFold models with target protein P97253

PDB/AF Accession PyMOL script Experimental / Predicted Interacting ECOD domains ECOD X-group name LigPlot
8FB9 Download Experimental e8fb9M1
e8fb9Y1
e8fb9a1
e8fb9b1
e8fb9M1
e8fb9N1
e8fb9O1
e8fb9a1
e8fb9M1
e8fb9O1
e8fb9Q1
e8fb9P1
e8fb9O1
e8fb9Q1
e8fb9S1
e8fb9R1
e8fb9Q1
e8fb9S1
e8fb9U1
e8fb9T1
e8fb9S1
e8fb9U1
e8fb9W1
e8fb9V1
e8fb9U1
e8fb9W1
e8fb9Y1
e8fb9X1
e8fb9W1
e8fb9Y1
e8fb9a1
e8fb9Z1
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
LigPlot
7TUW Download Experimental e7tuwM1
e7tuwY1
e7tuwa1
e7tuwb1
e7tuwM1
e7tuwO1
e7tuwa1
e7tuwN1
e7tuwM1
e7tuwO1
e7tuwQ1
e7tuwP1
e7tuwO1
e7tuwQ1
e7tuwS1
e7tuwR1
e7tuwQ1
e7tuwS1
e7tuwU1
e7tuwT1
e7tuwS1
e7tuwU1
e7tuwW1
e7tuwV1
e7tuwU1
e7tuwW1
e7tuwY1
e7tuwX1
e7tuwW1
e7tuwY1
e7tuwa1
e7tuwZ1
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
LigPlot
8FBB Download Experimental e8fbbg1
e8fbbI1
e8fbbK1
e8fbbL1
e8fbbg1
e8fbbC1
e8fbbD1
e8fbbE1
e8fbbg1
e8fbbD1
e8fbbK1
e8fbbB1
e8fbbC1
e8fbbD1
e8fbbG1
e8fbbF1
e8fbbI1
e8fbbM1
e8fbbO1
e8fbbP1
e8fbbI1
e8fbbK1
e8fbbO1
e8fbbJ1
e8fbbC1
e8fbbG1
e8fbbM1
e8fbbH1
e8fbbG1
e8fbbM1
e8fbbO1
e8fbbN1
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
LigPlot
1LGH Download Experimental e1lghA1
e1lghB1
e1lghD1
e1lghA1
e1lghB1
e1lghD1
e1lghE1
e1lghJ1
e1lghG1
e1lghH1
e1lghJ1
e1lghG1
e1lghK1
e1lghH1
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
LigPlot
7TV3 Download Experimental e7tv3A1
e7tv3I1
e7tv3K1
e7tv3L1
e7tv3A1
e7tv3C1
e7tv3D1
e7tv3E1
e7tv3A1
e7tv3D1
e7tv3K1
e7tv3B1
e7tv3C1
e7tv3D1
e7tv3G1
e7tv3F1
e7tv3I1
e7tv3M1
e7tv3O1
e7tv3P1
e7tv3I1
e7tv3K1
e7tv3O1
e7tv3J1
e7tv3C1
e7tv3G1
e7tv3M1
e7tv3H1
e7tv3G1
e7tv3M1
e7tv3O1
e7tv3N1
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
LigPlot