PDB ligand accession: LYC
DrugBank: DB11231
PubChem:
ChEMBL:
InChI Key: OAIJSZIZWZSQBC-GYZMGTAESA-N
SMILES: CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C)C)C)C)C
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Tetraterpenoids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 8FB9 | Download | Experimental | e8fb9M1 e8fb9Y1 e8fb9a1 e8fb9b1 e8fb9M1 e8fb9N1 e8fb9O1 e8fb9a1 e8fb9M1 e8fb9O1 e8fb9Q1 e8fb9P1 e8fb9O1 e8fb9Q1 e8fb9S1 e8fb9R1 e8fb9Q1 e8fb9S1 e8fb9U1 e8fb9T1 e8fb9S1 e8fb9U1 e8fb9W1 e8fb9V1 e8fb9U1 e8fb9W1 e8fb9Y1 e8fb9X1 e8fb9W1 e8fb9Y1 e8fb9a1 e8fb9Z1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 7TUW | Download | Experimental | e7tuwM1 e7tuwY1 e7tuwa1 e7tuwb1 e7tuwM1 e7tuwO1 e7tuwa1 e7tuwN1 e7tuwM1 e7tuwO1 e7tuwQ1 e7tuwP1 e7tuwO1 e7tuwQ1 e7tuwS1 e7tuwR1 e7tuwQ1 e7tuwS1 e7tuwU1 e7tuwT1 e7tuwS1 e7tuwU1 e7tuwW1 e7tuwV1 e7tuwU1 e7tuwW1 e7tuwY1 e7tuwX1 e7tuwW1 e7tuwY1 e7tuwa1 e7tuwZ1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 8FBB | Download | Experimental | e8fbbg1 e8fbbI1 e8fbbK1 e8fbbL1 e8fbbg1 e8fbbC1 e8fbbD1 e8fbbE1 e8fbbg1 e8fbbD1 e8fbbK1 e8fbbB1 e8fbbC1 e8fbbD1 e8fbbG1 e8fbbF1 e8fbbI1 e8fbbM1 e8fbbO1 e8fbbP1 e8fbbI1 e8fbbK1 e8fbbO1 e8fbbJ1 e8fbbC1 e8fbbG1 e8fbbM1 e8fbbH1 e8fbbG1 e8fbbM1 e8fbbO1 e8fbbN1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 1LGH | Download | Experimental | e1lghA1 e1lghB1 e1lghD1 e1lghA1 e1lghB1 e1lghD1 e1lghE1 e1lghJ1 e1lghG1 e1lghH1 e1lghJ1 e1lghG1 e1lghK1 e1lghH1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 7TV3 | Download | Experimental | e7tv3A1 e7tv3I1 e7tv3K1 e7tv3L1 e7tv3A1 e7tv3C1 e7tv3D1 e7tv3E1 e7tv3A1 e7tv3D1 e7tv3K1 e7tv3B1 e7tv3C1 e7tv3D1 e7tv3G1 e7tv3F1 e7tv3I1 e7tv3M1 e7tv3O1 e7tv3P1 e7tv3I1 e7tv3K1 e7tv3O1 e7tv3J1 e7tv3C1 e7tv3G1 e7tv3M1 e7tv3H1 e7tv3G1 e7tv3M1 e7tv3O1 e7tv3N1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |