PDB ligand accession: MAY
DrugBank: DB02465
PubChem:
ChEMBL: n/a
InChI Key: KWKZCGMJGHHOKJ-WTIHWRCNSA-N
SMILES: CCCCCC=CCC=CCC=CCC=CCCCCP(=O)(OC)F
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Organic phosphonic acids and derivatives
- Subclass: Phosphonic acid esters
- Class: Organic phosphonic acids and derivatives
- Superclass: Organic acids and derivatives
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 1MT5 | Download | Experimental | e1mt5A1 e1mt5B1 e1mt5C1 e1mt5D1 e1mt5E1 e1mt5F1 e1mt5G1 e1mt5H1 e1mt5I1 e1mt5J1 e1mt5K1 e1mt5L1 e1mt5M1 e1mt5N1 e1mt5O1 e1mt5P1 | Amidase signature (AS) enzymes Amidase signature (AS) enzymes Amidase signature (AS) enzymes Amidase signature (AS) enzymes Amidase signature (AS) enzymes Amidase signature (AS) enzymes Amidase signature (AS) enzymes Amidase signature (AS) enzymes Amidase signature (AS) enzymes Amidase signature (AS) enzymes Amidase signature (AS) enzymes Amidase signature (AS) enzymes Amidase signature (AS) enzymes Amidase signature (AS) enzymes Amidase signature (AS) enzymes Amidase signature (AS) enzymes | LigPlot |