PDB ligand accession: FMX
DrugBank: DB07778
PubChem:
ChEMBL:
InChI Key: PCCSBWNGDMYFCW-QFIPXVFZSA-N
SMILES: CC1(C(=O)N(C(=O)O1)Nc2ccccc2)c3ccc(cc3)Oc4ccccc4
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Diphenylethers
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
5KKZ | Download | Experimental | e5kkzA1 e5kkzA2 e5kkzG1 e5kkzE1 e5kkzE2 e5kkzC2 e5kkzK1 e5kkzK2 e5kkzQ3 e5kkzO1 e5kkzO2 e5kkzM1 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Trm112p-like a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle Trm112p-like a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle Trm112p-like Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Trm112p-like | LigPlot |