PDB ligand accession: 3E6
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: SPYZRRVRFHDMJY-QMEMPQSWSA-N
SMILES: CC12CCCC(C1CCC34C2CCC(C3)(C(=C)C4)OC5C(C(C(C(O5)COC6C(C(C(C(O6)CO)O)O)O)O)O)OC7C(C(C(C(O7)CO)O)O)O)(C)C(=O)OC8C(C(C(C(O8)CO)O)O)O
Drug action: n/a
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 7ES0 | Download | Experimental | e7es0A1 e7es0A2 | UDP-Glycosyltransferase/glycogen phosphorylase UDP-Glycosyltransferase/glycogen phosphorylase | LigPlot |