PDB ligand accession: ATP
DrugBank: DB00171
PubChem:
ChEMBL:
InChI Key: ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES: c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Nucleosides, nucleotides, and analogues
- Class: Purine nucleotides
- Subclass: Purine ribonucleotides
- Class: Purine nucleotides
- Superclass: Nucleosides, nucleotides, and analogues
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
6C3O | Download | Experimental | e6c3oA1 e6c3oA2 e6c3oB1 e6c3oC1 e6c3oC2 e6c3oD1 e6c3oC2 e6c3oB1 e6c3oB2 e6c3oA1 e6c3oD1 e6c3oD2 | Voltage-gated ion channels Immunoglobulin-like beta-sandwich Voltage-gated ion channels Immunoglobulin-like beta-sandwich Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Immunoglobulin-like beta-sandwich Voltage-gated ion channels Voltage-gated ion channels Immunoglobulin-like beta-sandwich | LigPlot |
6C3P | Download | Experimental | e6c3pA2 e6c3pD1 e6c3pD2 e6c3pD1 e6c3pC1 e6c3pC2 e6c3pB1 e6c3pB2 e6c3pC2 | Voltage-gated ion channels Voltage-gated ion channels Immunoglobulin-like beta-sandwich Voltage-gated ion channels Immunoglobulin-like beta-sandwich Voltage-gated ion channels Voltage-gated ion channels Immunoglobulin-like beta-sandwich Voltage-gated ion channels | LigPlot |