PDB ligand accession: PEE
DrugBank: DB04327
PubChem: 9546757;44251425;
ChEMBL: n/a
InChI Key: MWRBNPKJOOWZPW-NYVOMTAGSA-N
SMILES: CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCCCCC=CCCCCCCCC
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Glycerophospholipids
- Subclass: Glycerophosphoethanolamines
- Class: Glycerophospholipids
- Superclass: Lipids and lipid-like molecules
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
5GUP | Download | Experimental | e5gupu2 e5gupw1 e5gupw1 e5gupw2 e5gupz1 e5gupw1 e5gup11 e5gup21 e5gup52 e5gup72 e5gup41 e5gupAd1 e5gup71 e5gup72 e5gupAa1 | LuxS, MPP, ThrRS/AlaRS common domain Transmembrane heme-binding four-helical bundle Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Ubiquinone-binding protein QP-C of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle Subunit X (non-heme 7 kDa protein) of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) iron-sulfur subunit (ISP) transmembrane anchor LuxS, MPP, ThrRS/AlaRS common domain Transmembrane heme-binding four-helical bundle iron-sulfur subunit (ISP) transmembrane anchor Subunit XI (6.4 kDa protein) of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle Ubiquinone-binding protein QP-C of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) | LigPlot |