Ligand name: SPIRILLOXANTHIN
PDB ligand accession: CRT
DrugBank: n/a
PubChem: 5287981
ChEMBL: n/a
InChI Key: VAZQBTJCYODOSV-RISZBRKMSA-N
SMILES: CC(=CC=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=CCC(C)(C)OC)C)C)C=CCC(C)(C)OC
Drug action: n/a

ClassyFire chemical classification:

• Kingdom: Organic compounds
  • Superclass: Lipids and lipid-like molecules
    • Class: Prenol lipids
      • Subclass: Tetraterpenoids

List of PDB structures and/or AlphaFold models with target protein Q2RQ23

PDB/AF Accession	PyMOL script	Experimental / Predicted	Interacting ECOD domains	ECOD X-group name	LigPlot
7OY8	Download	Experimental	e7oy811 e7oy821 e7oy8X1 e7oy8Z1 e7oy831 e7oy821 e7oy841 e7oy8Z1 e7oy851 e7oy821 e7oy841 e7oy861 e7oy871 e7oy841 e7oy861 e7oy881 e7oy8M1 e7oy891 e7oy861 e7oy881 e7oy8D1 e7oy8I1 e7oy881 e7oy8D1 e7oy8E1 e7oy8U1 e7oy8A1 e7oy8J1 e7oy8N1 e7oy8K1 e7oy8D1 e7oy8E1 e7oy8F1 e7oy8W1 e7oy8A1 e7oy8N1 e7oy8R1 e7oy8O1 e7oy8Q1 e7oy8E1 e7oy8F1 e7oy8G1 e7oy8Q1 e7oy8F1 e7oy8G1 e7oy8J1 e7oy8S1 e7oy8G1 e7oy8J1 e7oy8N1 e7oy8Y1 e7oy8A1 e7oy8T1 e7oy8R1 e7oy8d1 e7oy8T1 e7oy8V1 e7oy8R1 e7oy8m1 e7oy8T1 e7oy8V1 e7oy8X1 e7oy8n1 e7oy8V1 e7oy8X1 e7oy8Z1	Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot
7EQD	Download	Experimental	e7eqdA1 e7eqdB1 e7eqdD1 e7eqd91 e7eqdA1 e7eqdD1 e7eqdF1 e7eqdE1 e7eqdD1 e7eqdF1 e7eqdI1 e7eqdG1 e7eqdF1 e7eqdI1 e7eqdK1 e7eqdJ1 e7eqdI1 e7eqdK1 e7eqdO1 e7eqdN1 e7eqdK1 e7eqdO1 e7eqdQ1 e7eqdP1 e7eqdM1 e7eqdO1 e7eqdQ1 e7eqdS1 e7eqdR1 e7eqdQ1 e7eqdS1 e7eqdU1 e7eqdT1 e7eqdS1 e7eqdU1 e7eqdW1 e7eqdV1 e7eqdU1 e7eqdW1 e7eqdY1 e7eqdX1 e7eqdW1 e7eqdY1 e7eqd11 e7eqdZ1 e7eqdY1 e7eqd11 e7eqd31 e7eqd21 e7eqd11 e7eqd31 e7eqd51 e7eqd41 e7eqd31 e7eqd51 e7eqd71 e7eqd61 e7eqd51 e7eqd71 e7eqd91 e7eqd81 e7eqdA1 e7eqd71 e7eqd91 e7eqd01	Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot