Ligand name: SPIRILLOXANTHIN
PDB ligand accession: CRT
DrugBank: n/a
PubChem: 5287981
ChEMBL: n/a
InChI Key: VAZQBTJCYODOSV-RISZBRKMSA-N
SMILES: CC(=CC=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=CCC(C)(C)OC)C)C)C=CCC(C)(C)OC
Drug action: n/a

ClassyFire chemical classification:

• Kingdom: Organic compounds
  • Superclass: Lipids and lipid-like molecules
    • Class: Prenol lipids
      • Subclass: Tetraterpenoids

List of PDB structures and/or AlphaFold models with target protein Q2RQ24

PDB/AF Accession	PyMOL script	Experimental / Predicted	Interacting ECOD domains	ECOD X-group name	LigPlot
7OY8	Download	Experimental	e7oy811 e7oy821 e7oy8X1 e7oy8Z1 e7oy831 e7oy821 e7oy841 e7oy8Z1 e7oy851 e7oy821 e7oy841 e7oy861 e7oy871 e7oy841 e7oy861 e7oy881 e7oy8M1 e7oy891 e7oy861 e7oy881 e7oy8D1 e7oy8I1 e7oy881 e7oy8D1 e7oy8E1 e7oy8U1 e7oy8A1 e7oy8J1 e7oy8N1 e7oy8K1 e7oy8D1 e7oy8E1 e7oy8F1 e7oy861 e7oy881 e7oy8M1 e7oy8W1 e7oy8A1 e7oy8N1 e7oy8R1 e7oy8O1 e7oy8Q1 e7oy8E1 e7oy8F1 e7oy8G1 e7oy8Q1 e7oy8F1 e7oy8G1 e7oy8J1 e7oy8S1 e7oy8G1 e7oy8J1 e7oy8N1 e7oy8Y1 e7oy8A1 e7oy8T1 e7oy8R1 e7oy8d1 e7oy8T1 e7oy8V1 e7oy8R1 e7oy8m1 e7oy8T1 e7oy8V1 e7oy8X1 e7oy8n1 e7oy8V1 e7oy8X1 e7oy8Z1	Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot