PDB ligand accession: 07D
DrugBank: n/a
PubChem: n/a
ChEMBL: n/a
InChI Key: ZBSZXIUSELHDGQ-POZHEDQMSA-M
SMILES: CCc1c(c2n3c1C=C4C(=C5C(=O)C(C6=C7C(=C(C8=CC9=[N]([Mg]3(N87)[N]4=C65)C(=C2)C(=C9C)C(=O)C)C)CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(=O)OC)C)C
Drug action: n/a
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
7OY8 | Download | Experimental | e7oy851 e7oy871 e7oy841 e7oy861 e7oy8M1 e7oy8L1 e7oy8M1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like | LigPlot |
7EQD | Download | Experimental | e7eqdL1 e7eqdM1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like | LigPlot |