Ligand name: Trans-Geranyl BACTERIOCHLOROPHYLL A
PDB ligand accession: 07D
DrugBank: n/a
PubChem: n/a
ChEMBL: n/a
InChI Key: ZBSZXIUSELHDGQ-POZHEDQMSA-M
SMILES: CCc1c(c2n3c1C=C4C(=C5C(=O)C(C6=C7C(=C(C8=CC9=[N]([Mg]3(N87)[N]4=C65)C(=C2)C(=C9C)C(=O)C)C)CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(=O)OC)C)C
Drug action: n/a

List of PDB structures and/or AlphaFold models with target protein Q2RWS4

PDB/AF Accession	PyMOL script	Experimental / Predicted	Interacting ECOD domains	ECOD X-group name	LigPlot
7OY8	Download	Experimental	e7oy8O1 e7oy8Q1 e7oy8F1 e7oy8G1 e7oy8H1 e7oy8F1 e7oy8G1 e7oy8H1 e7oy8H2	Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits SH3 Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits SH3 Photosystem II reaction centre subunit H, transmembrane region	LigPlot