Ligand name: SPHEROIDENE
PDB ligand accession: 7OT
DrugBank: n/a
PubChem: 6368932
ChEMBL: n/a
InChI Key: FJOCMTHZSURUFA-AXYGSFPTSA-N
SMILES: CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=CCC(C)(C)OC)C)C)C)C
Drug action: n/a

ClassyFire chemical classification:

• Kingdom: Organic compounds
  • Superclass: Lipids and lipid-like molecules
    • Class: Prenol lipids
      • Subclass: Tetraterpenoids

List of PDB structures and/or AlphaFold models with target protein Q3J144

PDB/AF Accession	PyMOL script	Experimental / Predicted	Interacting ECOD domains	ECOD X-group name	LigPlot
7PBW	Download	Experimental	e7pbwAA1 e7pbwAB1 e7pbwAC1 e7pbwBB1 e7pbwBC1 e7pbwAB1 e7pbwAC1 e7pbwAD1 e7pbwBC1 e7pbwBD1 e7pbwAC1 e7pbwAD1 e7pbwAE1 e7pbwBD1 e7pbwBE1 e7pbwAD1 e7pbwAE1 e7pbwAF1 e7pbwBE1 e7pbwBF1 e7pbwAE1 e7pbwAF1 e7pbwAG1 e7pbwBF1 e7pbwBG1 e7pbwAF1 e7pbwAG1 e7pbwAH1 e7pbwBG1 e7pbwBH1 e7pbwAG1 e7pbwAH1 e7pbwAI1 e7pbwBH1 e7pbwBI1 e7pbwAA1 e7pbwAH1 e7pbwAI1 e7pbwBA1 e7pbwBI1 e7pbwAA1 e7pbwAB1 e7pbwAI1 e7pbwBA1 e7pbwBB1	Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot