PDB ligand accession: SPO
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: FJOCMTHZSURUFA-KXCOHNEYSA-N
SMILES: CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=CCC(C)(C)OC)C)C)C)C
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Tetraterpenoids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
7VNY | Download | Experimental | e7vnyM1 e7vnyO1 e7vnyQ1 e7vnyA1 e7vnyD1 e7vny91 e7vnyB1 e7vny01 e7vnyD1 e7vnyB1 e7vnyE1 e7vnyD1 e7vnyF1 e7vnyE1 e7vnyG1 e7vnyD1 e7vnyF1 e7vnyI1 e7vnyE1 e7vnyG1 e7vnyF1 e7vnyI1 e7vnyG1 e7vnyJ1 e7vnyI1 e7vnyK1 e7vnyO1 e7vnyJ1 e7vnyN1 e7vnyI1 e7vnyK1 e7vnyJ1 e7vnyN1 e7vnyK1 e7vnyO1 e7vnyN1 e7vnyP1 e7vnyO1 e7vnyQ1 e7vnyS1 e7vnyP1 e7vnyR1 e7vnyQ1 e7vnyP1 e7vnyR1 e7vnyS1 e7vnyR1 e7vnyT1 e7vnyS1 e7vnyU1 e7vnyT1 e7vnyV1 e7vnyU1 e7vnyW1 e7vnyV1 e7vnyC1 e7vnyU1 e7vnyW1 e7vny31 e7vnyV1 e7vnyC1 e7vnyW1 e7vny31 e7vnyC1 e7vnyZ1 e7vny91 e7vny81 e7vny01 e7vnyA1 e7vny71 e7vny91 e7vny81 e7vny01 e7vnyA1 e7vnyB1 e7vny01 e7vny71 e7vny91 e7vny81 e7vnyX1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX | LigPlot |
7PIL | Download | Experimental | e7pilAA1 e7pilAB1 e7pilAC1 e7pilBA1 e7pilBB1 e7pilAB1 e7pilBA1 e7pilBB1 e7pilAB1 e7pilAC1 e7pilBB1 e7pilBC1 e7pilAD1 e7pilBC1 e7pilBD1 e7pilAD1 e7pilAE1 e7pilAF1 e7pilBE1 e7pilAE1 e7pilAF1 e7pilBE1 e7pilBF1 e7pilAF1 e7pilAG1 e7pilBF1 e7pilBG1 e7pilAG1 e7pilAH1 e7pilBG1 e7pilBH1 e7pilAI1 e7pilBH1 e7pilBI1 e7pilAJ1 e7pilBI1 e7pilBJ1 e7pilAJ1 e7pilAK1 e7pilBJ1 e7pilBK1 e7pilAK1 e7pilAL1 e7pilAM1 e7pilBL1 e7pilAL1 e7pilAM1 e7pilBL1 e7pilBM1 e7pilAA1 e7pilAB1 e7pilBA1 e7pilX1 e7pilAD1 e7pilAE1 e7pilBD1 e7pilBE1 e7pilAK1 e7pilAL1 e7pilBK1 e7pilBL1 e7pilAH1 e7pilAI1 e7pilM1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like | LigPlot |
7F0L | Download | Experimental | e7f0lM1 e7f0lS1 e7f0lV1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
7VA9 | Download | Experimental | e7va9M1 e7va9O1 e7va9Q1 e7va9A1 e7va9D1 e7va991 e7va9B1 e7va901 e7va9A1 e7va9D1 e7va9B1 e7va9E1 e7va9A1 e7va9D1 e7va9F1 e7va9B1 e7va9E1 e7va9D1 e7va9F1 e7va9I1 e7va9E1 e7va9G1 e7va9F1 e7va9I1 e7va9G1 e7va9J1 e7va9F1 e7va9I1 e7va9K1 e7va9G1 e7va9J1 e7va9K1 e7va9O1 e7va9Q1 e7va9P1 e7va9I1 e7va9K1 e7va9J1 e7va9N1 e7va9O1 e7va9Q1 e7va9P1 e7va9R1 e7va9O1 e7va9Q1 e7va9S1 e7va9R1 e7va9S1 e7va9R1 e7va9T1 e7va9Q1 e7va9S1 e7va9U1 e7va9T1 e7va9U1 e7va9T1 e7va9V1 e7va9S1 e7va9U1 e7va9W1 e7va9V1 e7va9h2 e7va971 e7va991 e7va981 e7va9C1 e7va9c1 e7va9A1 e7va971 e7va991 e7va981 e7va901 e7va991 e7va981 e7va901 e7va9m1 e7va9o1 e7va9q1 e7va9a1 e7va9b1 e7va9ab1 e7va9d1 e7va9f1 e7va9i1 e7va9g1 e7va9a1 e7va9d1 e7va9b1 e7va9e1 e7va9d1 e7va9f1 e7va9e1 e7va9g1 e7va9f1 e7va9i1 e7va9g1 e7va9j1 e7va9i1 e7va9k1 e7va9j1 e7va9n1 e7va9i1 e7va9k1 e7va9o1 e7va9n1 e7va9k1 e7va9o1 e7va9n1 e7va9p1 e7va9k1 e7va9o1 e7va9q1 e7va9p1 e7va9o1 e7va9q1 e7va9s1 e7va9r1 e7va9q1 e7va9p1 e7va9r1 e7va9s1 e7va9u1 e7va9w1 e7va9v1 e7va9u1 e7va9t1 e7va9v1 e7va961 e7va931 e7va9aa1 e7va9c1 e7va9a1 e7va961 e7va931 e7va9aa1 e7va9ab1 e7va931 e7va9aa1 e7va9ab1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits SH3 Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX Intrinsic membrane protein pufX Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
7VOR | Download | Experimental | e7vorM1 e7vorO1 e7vorQ1 e7vorA1 e7vorD1 e7vor91 e7vorB1 e7vor01 e7vorA1 e7vor91 e7vorB1 e7vor01 e7vorA1 e7vorD1 e7vorB1 e7vorE1 e7vorD1 e7vorF1 e7vorE1 e7vorG1 e7vorF1 e7vorI1 e7vorG1 e7vorJ1 e7vorF1 e7vorI1 e7vorK1 e7vorG1 e7vorJ1 e7vorI1 e7vorK1 e7vorJ1 e7vorN1 e7vorI1 e7vorK1 e7vorO1 e7vorJ1 e7vorN1 e7vorK1 e7vorO1 e7vorN1 e7vorP1 e7vorK1 e7vorO1 e7vorQ1 e7vorP1 e7vorQ1 e7vorS1 e7vorU1 e7vorR1 e7vorT1 e7vorS1 e7vorU1 e7vorW1 e7vorV1 e7vorU1 e7vorW1 e7vor31 e7vorC1 e7vorU1 e7vorW1 e7vorV1 e7vorC1 e7vorW1 e7vor31 e7vorC1 e7vorZ1 e7vorA1 e7vor71 e7vor91 e7vor81 e7vor01 e7vor71 e7vor91 e7vor81 e7vor01 e7vorh1 e7vor71 e7vor91 e7vor81 e7vorX1 e7vorx1 e7vorm1 e7voro1 e7vorq1 e7vora1 e7vord1 e7vorb91 e7vorb1 e7vorb01 e7vora1 e7vorb91 e7vorb1 e7vorb01 e7vora1 e7vord1 e7vorb1 e7vore1 e7vord1 e7vorf1 e7vore1 e7vorg1 e7vorf1 e7vori1 e7vorg1 e7vorj1 e7vorf1 e7vori1 e7vork1 e7vorg1 e7vorj1 e7vori1 e7vork1 e7vorj1 e7vorn1 e7vori1 e7vork1 e7voro1 e7vorj1 e7vorn1 e7vork1 e7voro1 e7vorn1 e7vorp1 e7vork1 e7voro1 e7vorq1 e7vorp1 e7vorq1 e7vors1 e7voru1 e7vorr1 e7vort1 e7vors1 e7voru1 e7vorw1 e7vorv1 e7voru1 e7vorw1 e7vor51 e7vorc1 e7voru1 e7vorw1 e7vorv1 e7vorc1 e7vorw1 e7vor51 e7vorc1 e7vorz1 e7vora1 e7vor61 e7vorb91 e7vorb81 e7vorb01 e7vor61 e7vorb91 e7vorb81 e7vorb01 e7vorH1 e7vor61 e7vorb91 e7vorb81 e7vorX1 e7vorx1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits SH3 Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX Intrinsic membrane protein pufX Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits SH3 Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX Intrinsic membrane protein pufX | LigPlot |
7VOT | Download | Experimental | e7votM1 e7votO1 e7votQ1 e7votA1 e7votD1 e7vot91 e7votB1 e7vot01 e7votA1 e7vot91 e7votB1 e7vot01 e7votA1 e7votD1 e7votF1 e7votB1 e7votE1 e7votA1 e7votD1 e7votB1 e7votE1 e7votD1 e7votF1 e7votE1 e7votG1 e7votF1 e7votI1 e7votG1 e7votJ1 e7votI1 e7votK1 e7votJ1 e7votN1 e7votK1 e7votO1 e7votN1 e7votP1 e7votK1 e7votO1 e7votQ1 e7votP1 e7votS1 e7votR1 e7votT1 e7votQ1 e7votS1 e7votU1 e7votT1 e7votS1 e7votU1 e7votW1 e7votV1 e7votU1 e7votW1 e7votV1 e7votC1 e7votU1 e7votW1 e7vot31 e7votC1 e7votW1 e7vot31 e7votC1 e7votZ1 e7voth2 e7vot71 e7vot91 e7vot81 e7votX1 e7votA1 e7vot71 e7vot91 e7vot81 e7vot01 e7vot71 e7vot91 e7vot81 e7vot01 e7votm1 e7voto1 e7votq1 e7vota1 e7votd1 e7votb91 e7votb1 e7votb01 e7vota1 e7votb91 e7votb1 e7votb01 e7vota1 e7votd1 e7votf1 e7votb1 e7vote1 e7vota1 e7votd1 e7votb1 e7vote1 e7votd1 e7votf1 e7vote1 e7votg1 e7votf1 e7voti1 e7votg1 e7votj1 e7voti1 e7votk1 e7votj1 e7votn1 e7votk1 e7voto1 e7votn1 e7votp1 e7votk1 e7voto1 e7votq1 e7votp1 e7vots1 e7votr1 e7vott1 e7votq1 e7vots1 e7votu1 e7vott1 e7vots1 e7votu1 e7votw1 e7votv1 e7votu1 e7votw1 e7votv1 e7votc1 e7votu1 e7votw1 e7vot51 e7votc1 e7votw1 e7vot51 e7votc1 e7votz1 e7votH2 e7vot61 e7votb91 e7votb81 e7votx1 e7vota1 e7vot61 e7votb91 e7votb81 e7votb01 e7vot61 e7votb91 e7votb81 e7votb01 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits SH3 Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits SH3 Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
7VB9 | Download | Experimental | e7vb9M1 e7vb9O1 e7vb9A1 e7vb9D1 e7vb9F1 e7vb9B1 e7vb9E1 e7vb9A1 e7vb9D1 e7vb9B1 e7vb9E1 e7vb9F1 e7vb9I1 e7vb9K1 e7vb9G1 e7vb9J1 e7vb9I1 e7vb9G1 e7vb9J1 e7vb9K1 e7vb9J1 e7vb9N1 e7vb9A1 e7vb971 e7vb991 e7vb981 e7vb901 e7vb991 e7vb981 e7vb901 e7vb971 e7vb991 e7vb981 e7vb9C1 e7vb9c1 e7vb9m1 e7vb9o1 e7vb9q1 e7vb9a1 e7vb9Q1 e7vb9b1 e7vb9ab1 e7vb9a1 e7vb9d1 e7vb9b1 e7vb9e1 e7vb9d1 e7vb9f1 e7vb9e1 e7vb9g1 e7vb9f1 e7vb9i1 e7vb9k1 e7vb9g1 e7vb9j1 e7vb9d1 e7vb9f1 e7vb9i1 e7vb9g1 e7vb9i1 e7vb9k1 e7vb9o1 e7vb9j1 e7vb9n1 e7vb9i1 e7vb9g1 e7vb9j1 e7vb9k1 e7vb9j1 e7vb9n1 e7vb9k1 e7vb9o1 e7vb9q1 e7vb9p1 e7vb9q1 e7vb9p1 e7vb9r1 e7vb9o1 e7vb9q1 e7vb9s1 e7vb9r1 e7vb9q1 e7vb9s1 e7vb9u1 e7vb9r1 e7vb9t1 e7vb9s1 e7vb9r1 e7vb9t1 e7vb9s1 e7vb9u1 e7vb9w1 e7vb9v1 e7vb9s1 e7vb9u1 e7vb9t1 e7vb9v1 e7vb9w1 e7vb9v1 e7vb9x1 e7vb961 e7vb9Q1 e7vb9aa1 e7vb9C1 e7vb9c1 e7vb9a1 e7vb961 e7vb9Q1 e7vb9aa1 e7vb9ab1 e7vb9Q1 e7vb9aa1 e7vb9ab1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX Intrinsic membrane protein pufX Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX Intrinsic membrane protein pufX Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
7VNM | Download | Experimental | e7vnmM1 e7vnmO1 e7vnmQ1 e7vnmA1 e7vnmD1 e7vnm91 e7vnmB1 e7vnm01 e7vnmD1 e7vnmF1 e7vnmI1 e7vnmE1 e7vnmG1 e7vnmF1 e7vnmE1 e7vnmG1 e7vnmF1 e7vnmI1 e7vnmK1 e7vnmG1 e7vnmJ1 e7vnmI1 e7vnmK1 e7vnmO1 e7vnmJ1 e7vnmN1 e7vnmK1 e7vnmO1 e7vnmQ1 e7vnmN1 e7vnmP1 e7vnmQ1 e7vnmP1 e7vnmR1 e7vnmQ1 e7vnmS1 e7vnmU1 e7vnmR1 e7vnmT1 e7vnmS1 e7vnmR1 e7vnmT1 e7vnmS1 e7vnmU1 e7vnmW1 e7vnmV1 e7vnmU1 e7vnmT1 e7vnmV1 e7vnm71 e7vnm91 e7vnm81 e7vnmX1 e7vnmA1 e7vnm71 e7vnm91 e7vnm81 e7vnm01 e7vnm91 e7vnm81 e7vnm01 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |