PDB ligand accession: SPO
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: FJOCMTHZSURUFA-KXCOHNEYSA-N
SMILES: CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=CCC(C)(C)OC)C)C)C)C
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Tetraterpenoids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 7VNY | Download | Experimental | e7vnyM1 e7vnyO1 e7vnyQ1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 7PIL | Download | Experimental | e7pilAH1 e7pilAI1 e7pilM1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like | LigPlot |
| 7F0L | Download | Experimental | e7f0lM1 e7f0lS1 e7f0lV1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 7VA9 | Download | Experimental | e7va9M1 e7va9O1 e7va9Q1 e7va9m1 e7va9o1 e7va9q1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 7VOR | Download | Experimental | e7vorM1 e7vorO1 e7vorQ1 e7vorm1 e7voro1 e7vorq1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 7VOT | Download | Experimental | e7votM1 e7votO1 e7votQ1 e7votm1 e7voto1 e7votq1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 7VB9 | Download | Experimental | e7vb9M1 e7vb9O1 e7vb9m1 e7vb9o1 e7vb9q1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 7VNM | Download | Experimental | e7vnmM1 e7vnmO1 e7vnmQ1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |