PDB ligand accession: U10
DrugBank: DB09270
PubChem:
ChEMBL:
InChI Key: ACTIUHUUMQJHFO-UPTCCGCDSA-N
SMILES: CC1=C(C(=O)C(=C(C1=O)OC)OC)CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Quinone and hydroquinone lipids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
6Z5R | Download | Experimental | e6z5rR1 e6z5rT1 e6z5rV1 e6z5rM1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like | LigPlot |
6Z5S | Download | Experimental | e6z5sM1 e6z5sL1 e6z5sH1 e6z5sC1 e6z5sL1 e6z5sA1 e6z5sM1 e6z5sL1 e6z5s11 e6z5sY1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Photosystem II reaction centre subunit H, transmembrane region Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |