PDB ligand accession: CRT
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: VAZQBTJCYODOSV-RISZBRKMSA-N
SMILES: CC(=CC=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=CCC(C)(C)OC)C)C)C=CCC(C)(C)OC
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Tetraterpenoids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 6Z5R | Download | Experimental | e6z5rC1 e6z5rE1 e6z5rA1 e6z5rD1 e6z5rB1 e6z5rC1 e6z5rE1 e6z5rG1 e6z5rF1 e6z5rE1 e6z5rG1 e6z5rJ1 e6z5rI1 e6z5rG1 e6z5rJ1 e6z5rN1 e6z5rK1 e6z5rJ1 e6z5rN1 e6z5rP1 e6z5rO1 e6z5rR1 e6z5rT1 e6z5rP1 e6z5rS1 e6z5rR1 e6z5rT1 e6z5rV1 e6z5rU1 e6z5rT1 e6z5rV1 e6z5rY1 e6z5rX1 e6z5rN1 e6z5rR1 e6z5rP1 e6z5rQ1 e6z5rV1 e6z5rY1 e6z5r11 e6z5rZ1 e6z5rC1 e6z5rA1 e6z5r91 e6z5rB1 e6z5rY1 e6z5r11 e6z5r31 e6z5rZ1 e6z5r21 e6z5r11 e6z5r31 e6z5r51 e6z5r41 e6z5r31 e6z5r51 e6z5r71 e6z5r61 e6z5r51 e6z5r71 e6z5r91 e6z5r81 e6z5rA1 e6z5r71 e6z5r91 e6z5r01 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 6Z5S | Download | Experimental | e6z5s11 e6z5s31 e6z5sY1 e6z5s21 e6z5sZ1 e6z5s11 e6z5s51 e6z5s31 e6z5s21 e6z5s41 e6z5s11 e6z5sY1 e6z5sV1 e6z5sZ1 e6z5sY1 e6z5sV1 e6z5sT1 e6z5sX1 e6z5sA1 e6z5sC1 e6z5sB1 e6z5sA1 e6z5sC1 e6z5sE1 e6z5sB1 e6z5sD1 e6z5sM1 e6z5sV1 e6z5sT1 e6z5sR1 e6z5sU1 e6z5sT1 e6z5sR1 e6z5sP1 e6z5sS1 e6z5sQ1 e6z5sR1 e6z5sP1 e6z5sN1 e6z5sQ1 e6z5sP1 e6z5sN1 e6z5sJ1 e6z5sO1 e6z5sN1 e6z5sJ1 e6z5sG1 e6z5sK1 e6z5sJ1 e6z5sG1 e6z5sE1 e6z5sI1 e6z5sF1 e6z5sC1 e6z5sG1 e6z5sE1 e6z5sF1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |