PDB ligand accession: LYC
DrugBank: DB11231
PubChem:
ChEMBL:
InChI Key: OAIJSZIZWZSQBC-GYZMGTAESA-N
SMILES: CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C)C)C)C)C
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Tetraterpenoids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 8FB9 | Download | Experimental | e8fb9A1 e8fb9c1 e8fb9e1 e8fb9f1 e8fb9A1 e8fb9B1 e8fb9D1 e8fb9e1 e8fb9C1 e8fb9I1 e8fb9K1 e8fb9L1 e8fb9C1 e8fb9G1 e8fb9K1 e8fb9F1 e8fb9A1 e8fb9D1 e8fb9I1 e8fb9E1 e8fb9D1 e8fb9I1 e8fb9K1 e8fb9J1 e8fb9C1 e8fb9G1 e8fb9c1 e8fb9H1 e8fb9G1 e8fb9c1 e8fb9e1 e8fb9d1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 7TUW | Download | Experimental | e7tuwA1 e7tuwc1 e7tuwe1 e7tuwf1 e7tuwA1 e7tuwD1 e7tuwe1 e7tuwB1 e7tuwC1 e7tuwI1 e7tuwK1 e7tuwL1 e7tuwC1 e7tuwG1 e7tuwK1 e7tuwF1 e7tuwA1 e7tuwD1 e7tuwI1 e7tuwE1 e7tuwD1 e7tuwI1 e7tuwK1 e7tuwJ1 e7tuwC1 e7tuwG1 e7tuwc1 e7tuwH1 e7tuwG1 e7tuwc1 e7tuwe1 e7tuwd1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 8FBB | Download | Experimental | e8fbbQ1 e8fbbY1 e8fbba1 e8fbbb1 e8fbbQ1 e8fbbS1 e8fbba1 e8fbbR1 e8fbbQ1 e8fbbS1 e8fbbU1 e8fbbT1 e8fbbS1 e8fbbU1 e8fbbW1 e8fbbV1 e8fbbY1 e8fbbc1 e8fbbe1 e8fbbf1 e8fbbY1 e8fbba1 e8fbbe1 e8fbbZ1 e8fbbU1 e8fbbW1 e8fbbc1 e8fbbX1 e8fbbW1 e8fbbc1 e8fbbe1 e8fbbd1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 7TV3 | Download | Experimental | e7tv3Q1 e7tv3Y1 e7tv3a1 e7tv3b1 e7tv3Q1 e7tv3S1 e7tv3a1 e7tv3R1 e7tv3Q1 e7tv3S1 e7tv3U1 e7tv3T1 e7tv3S1 e7tv3U1 e7tv3W1 e7tv3V1 e7tv3Y1 e7tv3c1 e7tv3e1 e7tv3f1 e7tv3Y1 e7tv3a1 e7tv3e1 e7tv3Z1 e7tv3U1 e7tv3W1 e7tv3c1 e7tv3X1 e7tv3W1 e7tv3c1 e7tv3e1 e7tv3d1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |