PDB ligand accession: P3D
DrugBank: n/a
PubChem: n/a
ChEMBL: n/a
InChI Key: NPYALNYUWCUSTP-OVCLIPMQSA-N
SMILES: Cc1c(c(c(cn1)COP(=O)(O)O)C=NCCCCCN)O
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pyridines and derivatives
- Subclass: Methylpyridines
- Class: Pyridines and derivatives
- Superclass: Organoheterocyclic compounds
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 2PLK | Download | Experimental | e2plkA1 e2plkA2 e2plkB1 e2plkA1 e2plkA2 e2plkB1 e2plkB2 | cradle loop barrel TIM beta/alpha-barrel cradle loop barrel cradle loop barrel TIM beta/alpha-barrel cradle loop barrel TIM beta/alpha-barrel | LigPlot |