PDB ligand accession: HEM
DrugBank: DB18267
PubChem: n/a
ChEMBL: n/a
InChI Key: KABFMIBPWCXCRK-RGGAHWMASA-L
SMILES: Cc1c2n3c(c1CCC(=O)O)C=C4C(=C(C5=[N]4[Fe]36[N]7=C(C=C8N6C(=C5)C(=C8C)C=C)C(=C(C7=C2)C)C=C)C)CCC(=O)O
Drug action: n/a
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 4H44 | Download | Experimental | e4h44A1 e4h44B1 e4h44H1 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetN subunit of the cytochrome b6f complex | LigPlot |
| 2ZT9 | Download | Experimental | e2zt9A1 e2zt9B1 e2zt9H1 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) PetN subunit of the cytochrome b6f complex | LigPlot |