PDB ligand accession: n/a
DrugBank: DB00400
InChI Key:
SMILES: COC1=CC(OC)=C(Cl)C2=C1C(=O)[C@]1(O2)[C@H](C)CC(=O)C=C1OC
Drug action: other/unknown
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name |
|---|---|---|---|---|
| Q99456 | Download | Predicted | Q99456_F1_nD1 Q99456_F1_nD2 Q99456_F1_nD3 | YscO-like Mitoribosomal protein mS26 F-type ATP synthase subunit b |