PDB ligand accession: Q7G
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: LKBFXDNKNZXHHW-NXLTVWPKSA-N
SMILES: CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)OCCC(COC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)CO)O)O)O)O)O)COC9C(C(C(C(O9)CO)OC2C(C(C(C(O2)CO)O)O)O)O)O)C)C)C)OC1
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Steroids and steroid derivatives
- Subclass: Steroidal glycosides
- Class: Steroids and steroid derivatives
- Superclass: Lipids and lipid-like molecules
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 8BPX | Download | Experimental | e8bpxH1 e8bpxX2 e8bpxa1 e8bpxH1 e8bpxK1 e8bpxZ1 e8bpxa1 e8bpxH1 e8bpxa1 | Sodium/proton antiporter subunits-like p8-MTCP1-related Mitochondrial complex I, MWFE subunit Sodium/proton antiporter subunits-like NADH-quinone oxidoreductase subunit K Mitochondrial complex I, B16.6 subunit Mitochondrial complex I, MWFE subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, MWFE subunit | LigPlot |
| 8BEF | Download | Experimental | e8befH1 e8befX2 e8befa1 e8befH1 e8befK1 e8befZ1 e8befa1 e8befH1 e8befa1 | Sodium/proton antiporter subunits-like p8-MTCP1-related Mitochondrial complex I, MWFE subunit Sodium/proton antiporter subunits-like NADH-quinone oxidoreductase subunit K Mitochondrial complex I, B16.6 subunit Mitochondrial complex I, MWFE subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, MWFE subunit | LigPlot |