Ligand name: 1-(5-bromopyridin-3-yl)-4-[cis-4-(3-methylphenyl)cyclohexyl]piperazine
PDB ligand accession: 81F
DrugBank: n/a
PubChem: n/a
ChEMBL: n/a
InChI Key: GPGOZHVXQXMXPF-RVWIWJKTSA-N
SMILES: Cc1cccc(c1)C2CCC(CC2)N3CCN(CC3)c4cc(cnc4)Br
Drug action: n/a

List of PDB structures and/or AlphaFold models with target protein Q9H1D0

PDB/AF Accession	PyMOL script	Experimental / Predicted	Interacting ECOD domains	ECOD X-group name	LigPlot
7K4C	Download	Experimental	e7k4cA2 e7k4cB1 e7k4cB1 e7k4cC2 e7k4cC2 e7k4cD1 e7k4cA2 e7k4cB1 e7k4cC2 e7k4cD1	Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels	LigPlot